- 2,3-Difluorotoluene
-
- $1.00 / 1KG
-
2024-07-16
- CAS:3828-49-7
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 20t
- 2,3-Difluorotoluene
-
- $1.00 / 1KG
-
2019-07-06
- CAS:3828-49-7
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: Customized
|
| | 2,3-Difluorotoluene Basic information |
| | 2,3-Difluorotoluene Chemical Properties |
| Boiling point | 119-121 °C (lit.) | | density | 1.096 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.4530(lit.) | | Fp | 15°C | | storage temp. | Sealed in dry,Room Temperature | | solubility | 0.24g/l | | form | liquid | | Specific Gravity | 1.120 | | color | Clear, faint lemon/lime | | BRN | 3235341 | | InChI | InChI=1S/C7H6F2/c1-5-3-2-4-6(8)7(5)9/h2-4H,1H3 | | InChIKey | ZNEHIDGAPGVZSA-UHFFFAOYSA-N | | SMILES | C1(F)=CC=CC(C)=C1F | | CAS DataBase Reference | 3828-49-7(CAS DataBase Reference) |
| Hazard Codes | Xn,F | | Risk Statements | 10-22-37/38-41 | | Safety Statements | 16-26-39 | | RIDADR | UN 1993 3/PG 2 | | WGK Germany | 2 | | Hazard Note | Flammable | | HazardClass | 3 | | PackingGroup | II | | HS Code | 29039990 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 Flam. Liq. 2 Skin Irrit. 2 STOT SE 3 |
| | 2,3-Difluorotoluene Usage And Synthesis |
| Chemical Properties | colorless to light yellow liqui |
| | 2,3-Difluorotoluene Preparation Products And Raw materials |
|