| Company Name: |
Cool Pharm, Ltd |
| Tel: |
021-60455363 18019463053 |
| Email: |
sales@coolpharm.com |
|
| | tert-Butyl (3-chloro-2-nitrophenyl)carbaMate Basic information |
| Product Name: | tert-Butyl (3-chloro-2-nitrophenyl)carbaMate | | Synonyms: | tert-Butyl (3-chloro-2-nitrophenyl)carbaMate;N-Boc-3-chloro-2-nitroaniline;N-(3-Chloro-2-nitrophenyl)carbamic acid 1,1-dimethylethyl ester;tert-butyl N-(3-chloro-2-nitrophenyl)carbamate;Carbamic acid, N-(3-chloro-2-nitrophenyl)-, 1,1-dimethylethyl ester | | CAS: | 1283176-45-3 | | MF: | C11H13ClN2O4 | | MW: | 272.68 | | EINECS: | | | Product Categories: | | | Mol File: | 1283176-45-3.mol |  |
| | tert-Butyl (3-chloro-2-nitrophenyl)carbaMate Chemical Properties |
| Boiling point | 329.1±32.0 °C(Predicted) | | density | 1.348±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | pka | 11.90±0.70(Predicted) |
| | tert-Butyl (3-chloro-2-nitrophenyl)carbaMate Usage And Synthesis |
| | tert-Butyl (3-chloro-2-nitrophenyl)carbaMate Preparation Products And Raw materials |
|