| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | Ethyl 5-chlorobenzofuran-3-carboxylate Basic information |
| | Ethyl 5-chlorobenzofuran-3-carboxylate Chemical Properties |
| Melting point | 58-63℃ | | storage temp. | 2-8°C | | form | solid | | InChI | 1S/C11H9ClO3/c1-2-14-11(13)9-6-15-10-4-3-7(12)5-8(9)10/h3-6H,2H2,1H3 | | InChIKey | CQHDKISUMTVOSI-UHFFFAOYSA-N | | SMILES | CCOC(=O)c1coc2ccc(Cl)cc12 |
| Hazard Codes | Xn | | Risk Statements | 22-38 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Skin Irrit. 2 |
| | Ethyl 5-chlorobenzofuran-3-carboxylate Usage And Synthesis |
| | Ethyl 5-chlorobenzofuran-3-carboxylate Preparation Products And Raw materials |
|