- AMPSO sodium salt
-
- $0.00 / 25g
-
2026-04-21
- CAS:102029-60-7
- Min. Order: 25g
- Purity: ≥98.0%
- Supply Ability: 10kg/month
- AMPSO sodium salt
-
- $1.10 / 1g
-
2025-11-18
- CAS:102029-60-7
- Min. Order: 1g
- Purity: 99.00%
- Supply Ability: 100 Tons Min
|
| | AMPSO sodium salt Basic information |
| Product Name: | AMPSO sodium salt | | Synonyms: | AMPSO sodium salt
3-((1,1-Dimethyl-2-hydroxyethyl)amino)-2-hydroxypropanesulfonic acid sodium salt;AMPSO SODIUM SALT;N-(1,1-DIMETHYL-2-HYDROXYETHYL)-3-AMINO-2-HYDROXYPROPANESULPHONIC ACID SODIUM SALT;AMPSO SODIUM;3-[(1,1-DIMETHYL-2-HYDROXYETHYL)AMINO]-2-HYDROXY-PROPANESULFONIC ACID SODIUM SALT;N-(1,1-Dimethyl-2-hydroxyethyl)-3-amino-2-hydroxypropanesulphonic acid sodium salt >98%;AMPSO-NA;2-hydroxy-3-[(1-hydroxy-2-methylpropan-2-yl)amino]propane-1-sulfonate | | CAS: | 102029-60-7 | | MF: | C7H16NNaO5S | | MW: | 249.26 | | EINECS: | 2017-001-1 | | Product Categories: | buffer | | Mol File: | 102029-60-7.mol |  |
| | AMPSO sodium salt Chemical Properties |
| solubility | water: 0.33 g/mL, clear to slightly hazy, colorless | | form | Crystals | | color | White | | PH | 8.3-9.7 | | PH Range | 8.3 - 9.7 | | pka | 9.0 (Free acid)(at 25℃) | | Water Solubility | water: 0.33g/mL, clear to slightly hazy, colorless | | Major Application | diagnostic assay manufacturing | | InChI | 1S/C7H17NO5S.Na/c1-7(2,5-9)8-3-6(10)4-14(11,12)13;/h6,8-10H,3-5H2,1-2H3,(H,11,12,13);/q;+1/p-1 | | InChIKey | UVGYCHPTWHWEPZ-UHFFFAOYSA-M | | SMILES | [Na+].CC(C)(CO)NCC(O)CS([O-])(=O)=O | | CAS DataBase Reference | 102029-60-7(CAS DataBase Reference) |
| Hazard Codes | Xn | | Risk Statements | 20/21/22-36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | HS Code | 29221980 | | Storage Class | 11 - Combustible Solids |
| | AMPSO sodium salt Usage And Synthesis |
| Chemical Properties | Crystalline powder | | Uses | diagnostic assay manufacturing |
| | AMPSO sodium salt Preparation Products And Raw materials |
|