CP-226269 manufacturers
- CP-226269
-
- $48.00
-
2026-08-08
- CAS:220941-93-5
- Purity: 99.95%
- Supply Ability: 10g
|
| | CP-226269 Basic information |
| | CP-226269 Chemical Properties |
| storage temp. | -20°C | | solubility | DMSO: >10mg/mL | | form | powder | | color | light tan | | InChI | 1S/C18H19FN4/c19-15-4-5-17-14(11-15)12-16(21-17)13-22-7-9-23(10-8-22)18-3-1-2-6-20-18/h1-6,11-12,21H,7-10,13H2 | | InChIKey | PQOIDBZLMJMYCD-UHFFFAOYSA-N | | SMILES | Fc1ccc2[nH]c(CN3CCN(CC3)c4ccccn4)cc2c1 |
| Storage Class | 11 - Combustible Solids |
| | CP-226269 Usage And Synthesis |
| Uses | CP-226269 is a D4 dopamine receptor agonist with EC50 of 32 nM for use in treating sexual dysfunction. | | Biological Activity | CP-226269 is a D4 dopamine receptor agonist with EC50 of 32 nM. |
| | CP-226269 Preparation Products And Raw materials |
|