| Company Name: |
T&W GROUP |
| Tel: |
021-61551611 13296011611 |
| Email: |
contact@trustwe.com |
|
| | Sodium (R)-alpha-lipoate Basic information |
| Product Name: | Sodium (R)-alpha-lipoate | | Synonyms: | R(+)-Alpha Lipoic Acid SodiuM;Sodium (R)-lipoate;Sodium 5-[(3R)-1,2-dithiolan-3-yl]pentanoate;(R)-1,2-Dithiolane-3-pentanoic acid sodium salt;Sodium (R)-alpha-lipoate;R-AlphaLipoicAcidSodiumSalt;R-alpha-Lipoic acid sodium (NaRALA, R-ALA Na);R-(+)-ALA Sodium | | CAS: | 176110-81-9 | | MF: | C8H15NaO2S2 | | MW: | 230.32 | | EINECS: | 229-567-4 | | Product Categories: | Pharm intermediate | | Mol File: | 176110-81-9.mol |  |
| | Sodium (R)-alpha-lipoate Chemical Properties |
| InChI | InChI=1/C8H14O2S2.Na.H/c9-8(10)4-2-1-3-7-5-6-11-12-7;;/h7H,1-6H2,(H,9,10);;/t7-;;/s3 | | InChIKey | WRBKEAUOTGDJNP-DCFBZVEJNA-N | | SMILES | C([C@H]1SSCC1)CCCC(=O)O.[NaH] |&1:1,r| |
| | Sodium (R)-alpha-lipoate Usage And Synthesis |
| Uses | Sodium (R)-alpha-lipoate is a potent antioxidant used to correct diabetic neuropathy and avoid nerve damage by enhancing glucose metabolism and reducing oxidative stress. In addition, it has a potential role in the treatment of Alzheimer's disease and multiple sclerosis. |
| | Sodium (R)-alpha-lipoate Preparation Products And Raw materials |
|