2,6-dichlorocapronic acid xylidide manufacturers
|
| | 2,6-dichlorocapronic acid xylidide Basic information |
| | 2,6-dichlorocapronic acid xylidide Chemical Properties |
| Melting point | 81 - 83°C | | Boiling point | 421.3±45.0 °C(Predicted) | | density | 1.180±0.06 g/cm3(Predicted) | | storage temp. | Hygroscopic, -20°C Freezer, Under inert atmosphere | | solubility | Chloroform (Slightly), Methanol (Slightly) | | pka | 13.00±0.70(Predicted) | | form | Solid | | color | Off-White to Pale Beige | | Stability: | Hygroscopic | | Major Application | pharmaceutical | | InChIKey | JHPMUNZBGKBWPW-UHFFFAOYSA-N | | SMILES | ClC(CCCCCl)C(NC1=C(C)C=CC=C1C)=O |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Aquatic Acute 1 Aquatic Chronic 1 Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 |
| | 2,6-dichlorocapronic acid xylidide Usage And Synthesis |
| Uses | 2,6-Dichloro-N-(2,6-dimethylphenyl)hexanamide is an impurity of the local anesthetic Levobupivacaine (B689546). |
| | 2,6-dichlorocapronic acid xylidide Preparation Products And Raw materials |
|