| Company Name: |
Energy Chemical
|
| Tel: |
021-021-58432009 400-005-6266 |
| Email: |
sales8178@energy-chemical.com |
| Products Intro: |
Product Name:(4-Benzyloxyphenyl)tributylstannane CAS:145745-05-7 Package:1G
|
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Products Intro: |
Product Name:(4-Benzyloxyphenyl)tributylstannane CAS:145745-05-7 Purity:(4-Benzyloxyphenyl)tributylstannane Package:1G Remarks:721131-1G
|
| Company Name: |
Henan Weitixi Chemical Technology Co., Ltd
|
| Tel: |
0371-53370800 18037197114 |
| Email: |
3807961510@qq.com |
| Products Intro: |
Product Name:(4-Benzyloxyphenyl)tributylstannane CAS:145745-05-7 Purity:98% Package:1g;5g;25g;100g;500g;1KG
|
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Email: |
ordercn@merckgroup.com |
| Products Intro: |
Product Name:(4-Benzyloxyphenyl)tributylstannane CAS:145745-05-7
|
|
| | (4-Benzyloxyphenyl)tributylstannane Basic information |
| Product Name: | (4-Benzyloxyphenyl)tributylstannane | | Synonyms: | (4-Benzyloxyphenyl)tributylstannane;[4-(Benzyloxy)phenyl]tributylstannane, Benzyl 4-(tributylstannyl)phenyl ether;1-(Benzyloxy)-4-(tributylstannyl)benzene;[4-(Benzyloxy)phenyl]tributyltin;tributyl-(4-phenylmethoxyphenyl)stannane;Stannane, tributyl[4-(phenylmethoxy)phenyl]-;SKL191 | | CAS: | 145745-05-7 | | MF: | C25H38OSn | | MW: | 473.28 | | EINECS: | | | Product Categories: | | | Mol File: | 145745-05-7.mol |  |
| | (4-Benzyloxyphenyl)tributylstannane Chemical Properties |
| Boiling point | 489.3±47.0 °C(Predicted) | | density | 1.128 g/cm3 at 25 °C | | refractive index | n20/D1.546 | | Fp | >110℃ | | form | liquid | | InChI | 1S/C13H11O.3C4H9.Sn/c1-3-7-12(8-4-1)11-14-13-9-5-2-6-10-13;3*1-3-4-2;/h1,3-10H,11H2;3*1,3-4H2,2H3; | | InChIKey | DRDMDSYSKAAPQQ-UHFFFAOYSA-N | | SMILES | CCCC[Sn](CCCC)(CCCC)c1ccc(OCc2ccccc2)cc1 |
| Hazard Codes | T,N | | Risk Statements | 21-25-36/38-48/23/25-50/53 | | Safety Statements | 36/37/39-45-60-61 | | RIDADR | UN 2788 6.1 / PGIII | | WGK Germany | 3 | | HS Code | 2931200000 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral Acute Tox. 4 Dermal Aquatic Acute 1 Aquatic Chronic 1 Eye Irrit. 2 Repr. 1B Skin Irrit. 2 STOT RE 1 Inhalation |
| | (4-Benzyloxyphenyl)tributylstannane Usage And Synthesis |
| Uses | Reactant for:
- Preparation of epoxy-substituted aryl alkenes by Stille coupling reactions with allylic carbonates
- Preparation of polycyclic meroterpenoids based on Stille couplings and titanocene catalysis
|
| | (4-Benzyloxyphenyl)tributylstannane Preparation Products And Raw materials |
|