| Company Name: |
BOC Sciences |
| Tel: |
16314854226 |
| Email: |
inquiry@bocsci.com |
5'-O-(4,4'-DiMethoxytrityl)-N6-Phenoxyacetyl adenosine manufacturers
|
| | 5'-O-(4,4'-DiMethoxytrityl)-N6-Phenoxyacetyl adenosine Basic information |
| Product Name: | 5'-O-(4,4'-DiMethoxytrityl)-N6-Phenoxyacetyl adenosine | | Synonyms: | 5'-O-(4,4'-DiMethoxytrityl)-N6-Phenoxyacetyl adenosine;5'-O-[bis(4-Methoxyphenyl)phenylMethyl]-N6-(2-phenoxyacetyl)adenosine;5'-O-[Bis(4-methoxyphenyl)phenylmethyl]-N-(phenoxyacetyl)adenosine;Adenosine, 5'-O-[bis(4-methoxyphenyl)phenylmethyl]-N-(2-phenoxyacetyl)-;5'-O-DMT-N6-(2-phenoxyacetyl)-adenosine;5’-O-[Bis(4-methoxyphenyl)phenylmethyl]-N6-(2-phenoxyacetyl)adenosine;5’-O-(4,4’-Dimethoxytrityl)-N6-Phenoxyacetyl adenosine;5’-O-DMTr-Adenosine (N-PAc) | | CAS: | 121076-16-2 | | MF: | C39H37N5O8 | | MW: | 703.75 | | EINECS: | | | Product Categories: | | | Mol File: | 121076-16-2.mol |  |
| | 5'-O-(4,4'-DiMethoxytrityl)-N6-Phenoxyacetyl adenosine Chemical Properties |
| density | 1.36±0.1 g/cm3(Predicted) | | pka | 7.87±0.43(Predicted) | | InChIKey | GWFRSQBGIGLMFD-FACGFYODNA-N | | SMILES | C(C1C=CC=CC=1)(C1C=CC(OC)=CC=1)(C1C=CC(OC)=CC=1)OC[C@@H]1[C@H]([C@@H](O)[C@H](N2C=NC3C(=NC=NC2=3)NC(=O)COC2C=CC=CC=2)O1)O |&1:25,26,27,29,r| |
| | 5'-O-(4,4'-DiMethoxytrityl)-N6-Phenoxyacetyl adenosine Usage And Synthesis |
| Uses | 5’-O-(4,4’-Dimethoxytrityl)-N6-phenoxyacetyl adenosine is an adenosine analog. Adenosine analogs mostly act as smooth muscle vasodilators and have also been shown to inhibit cancer progression. Its popular products are adenosine phosphate, Acadesine (HY-13417), Clofarabine (HY-A0005), Fludarabine phosphate (HY-B0028) and Vidarabine (HY-B0277)[1]. | | References | [1] Man S, et al. Potential and promising anticancer drugs from adenosine and its analogs. Drug Discov Today. 2021 Jun;26(6):1490-1500. DOI:10.1016/j.drudis.2021.02.020 |
| | 5'-O-(4,4'-DiMethoxytrityl)-N6-Phenoxyacetyl adenosine Preparation Products And Raw materials |
|