|
|
| | 4-BroMobenzenesulfonyl fluoride Basic information |
| Product Name: | 4-BroMobenzenesulfonyl fluoride | | Synonyms: | 4-BroMobenzenesulfonyl fluoride;AOXWZFUBFROIHA-UHFFFAOYSA-N;4-bromobenzene-1-sulfonyl fluoride;Benzenesulfonyl fluoride, 4-bromo-;4-bromo-4-Bromo-benzenesulfonyl fluoride 4-Bromobenzenesulfonyl fluoride;4-Bromo-benzenesulfonyl fluoride | | CAS: | 498-83-9 | | MF: | C6H4BrFO2S | | MW: | 239.06 | | EINECS: | | | Product Categories: | | | Mol File: | 498-83-9.mol |  |
| | 4-BroMobenzenesulfonyl fluoride Chemical Properties |
| Melting point | 60-65°C | | Boiling point | 256.0±23.0 °C(Predicted) | | density | 1.753±0.06 g/cm3(Predicted) | | storage temp. | Store at room temperature, keep dry and cool | | form | solid | | color | Beige | | InChI | InChI=1S/C6H4BrFO2S/c7-5-1-3-6(4-2-5)11(8,9)10/h1-4H | | InChIKey | AOXWZFUBFROIHA-UHFFFAOYSA-N | | SMILES | C1(S(F)(=O)=O)=CC=C(Br)C=C1 |
| Hazard Codes | C | | Risk Statements | 34 | | Safety Statements | 26-36/37/39-45 | | RIDADR | UN 3261 8 / PGII | | WGK Germany | 3 | | HS Code | 2930909899 |
| | 4-BroMobenzenesulfonyl fluoride Usage And Synthesis |
| | 4-BroMobenzenesulfonyl fluoride Preparation Products And Raw materials |
|