|
|
| | 1H-Pyrrole-3-carboxylic acid, 5-(2-fluorophenyl)-, ethyl ester Basic information |
| Product Name: | 1H-Pyrrole-3-carboxylic acid, 5-(2-fluorophenyl)-, ethyl ester | | Synonyms: | 1H-Pyrrole-3-carboxylic acid, 5-(2-fluorophenyl)-, ethyl ester;5-(2-Fluorophenyl)-1H-pyrrole-3-carboxylic acid ethyl ester;5-(2-Fluorophenyl)-1H-pyrrole-3-carboxylic acid ethyl;1H-Pyrrole-3-carboxylic acid, 5-(2-fluorophenyl)-, ethyl est...;TAK438 Intermediate 8;Vonoprazan-066;Vonoprazan Impurity 187;TAK438 Impurity 172 | | CAS: | 881674-06-2 | | MF: | C13H12FNO2 | | MW: | 233.24 | | EINECS: | | | Product Categories: | | | Mol File: | 881674-06-2.mol |  |
| | 1H-Pyrrole-3-carboxylic acid, 5-(2-fluorophenyl)-, ethyl ester Chemical Properties |
| Boiling point | 424.7±35.0 °C(Predicted) | | density | 1.217±0.06 g/cm3 (20 ºC 760 Torr) | | pka | 14.68±0.50(Predicted) | | InChI | InChI=1S/C13H12FNO2/c1-2-17-13(16)9-7-12(15-8-9)10-5-3-4-6-11(10)14/h3-8,15H,2H2,1H3 | | InChIKey | KXQMTNMMOMBDLC-UHFFFAOYSA-N | | SMILES | N1C(C2=CC=CC=C2F)=CC(C(OCC)=O)=C1 |
| | 1H-Pyrrole-3-carboxylic acid, 5-(2-fluorophenyl)-, ethyl ester Usage And Synthesis |
| Uses | Ethyl 5-(2-fluorophenyl)-1H-pyrrole-3-carboxylate is a useful research chemical compound is a useful research chemical compound used in the preparation of TAK-438, a potassium competitive acid blocker. |
| | 1H-Pyrrole-3-carboxylic acid, 5-(2-fluorophenyl)-, ethyl ester Preparation Products And Raw materials |
|