- cis-2,6-Dimethylmorpholine
-
- $5.00 / 1KG
-
2025-09-25
- CAS:6485-55-8
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: g-kg-tons, free sample is available
|
| | cis-2,6-Dimethylmorpholine Basic information |
| Product Name: | cis-2,6-Dimethylmorpholine | | Synonyms: | CIS-2,6-DIMETHYLMORPHOLINE;Cis-2,6-Methylmorpoline;P-methoxy-alpha-Bromoacetophenone;Cdmm;(Z)-2,6-Dimethylmorpholine;cis-2,6-Dimethylmorpholine,97%;cis-2,6-Dimethylmorpoline;cis-2,6-Dimethylmorpholin | | CAS: | 6485-55-8 | | MF: | C6H13NO | | MW: | 115.17 | | EINECS: | 229-353-0 | | Product Categories: | Amines and Anilines | | Mol File: | 6485-55-8.mol |  |
| | cis-2,6-Dimethylmorpholine Chemical Properties |
| Melting point | -85 °C | | Boiling point | 140-142 °C | | density | 0.93 | | vapor pressure | 3.38-5.4hPa at 15.1-21.9℃ | | refractive index | 1.445-1.447 | | Fp | 41 °C | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | solubility | Chloroform (Sparingly), Dichloromethane (Sparingly), Methanol (Slightly) | | pka | 9.04±0.60(Predicted) | | form | Liquid | | color | Clear colorless | | BRN | 878182 | | InChI | InChI=1/C6H13NO/c1-5-3-7-4-6(2)8-5/h5-7H,3-4H2,1-2H3/t5-,6+ | | InChIKey | HNVIQLPOGUDBSU-OLQVQODUNA-N | | SMILES | N1C[C@H](C)O[C@H](C)C1 |&1:2,5,r| | | LogP | -0.15 at 25℃ | | CAS DataBase Reference | 6485-55-8(CAS DataBase Reference) |
| | cis-2,6-Dimethylmorpholine Usage And Synthesis |
| Chemical Properties | clear colorless liquid | | Uses |
Cis-2,6-Dimethylmorpholine is used in the synthesis of p38α MAP kinase inhibitors used in the treatment of autoimmune diseases. Also used towards the synthesis of potent agonists and antagonists of 5-HT 4 receptors.
|
| | cis-2,6-Dimethylmorpholine Preparation Products And Raw materials |
|