3,3',5,5'-Tetrakis(MethoxyMethyl)-[1,1'-biphenyl]-4,4'-diol manufacturers
|
| | 3,3',5,5'-Tetrakis(MethoxyMethyl)-[1,1'-biphenyl]-4,4'-diol Basic information |
| Product Name: | 3,3',5,5'-Tetrakis(MethoxyMethyl)-[1,1'-biphenyl]-4,4'-diol | | Synonyms: | 3,3',5,5'-Tetrakis(MethoxyMethyl)-[1,1'-biphenyl]-4,4'-diol;[1,1'-Biphenyl]-4,4'-diol, 3,3',5,5'-tetrakis(methoxymethyl)-;TMOM-BP;TIANFUCHEM--455943-61-0---C20H26O6;3,3',5,5'-Tetramethoxymethyl Biphenol | | CAS: | 455943-61-0 | | MF: | C20H26O6 | | MW: | 362.42 | | EINECS: | | | Product Categories: | | | Mol File: | 455943-61-0.mol | ![3,3',5,5'-Tetrakis(MethoxyMethyl)-[1,1'-biphenyl]-4,4'-diol Structure](CAS/20150408/GIF/455943-61-0.gif) |
| | 3,3',5,5'-Tetrakis(MethoxyMethyl)-[1,1'-biphenyl]-4,4'-diol Chemical Properties |
| Boiling point | 432.7±40.0 °C(Predicted) | | density | 1.175±0.06 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Room Temperature | | pka | 8.75±0.50(Predicted) | | Appearance | Off-white to light yellow Solid | | InChI | InChI=1S/C20H26O6/c1-23-9-15-5-13(6-16(10-24-2)19(15)21)14-7-17(11-25-3)20(22)18(8-14)12-26-4/h5-8,21-22H,9-12H2,1-4H3 | | InChIKey | JHIUAEPQGMOWHS-UHFFFAOYSA-N | | SMILES | C1(C2=CC(COC)=C(O)C(COC)=C2)=CC(COC)=C(O)C(COC)=C1 |
| | 3,3',5,5'-Tetrakis(MethoxyMethyl)-[1,1'-biphenyl]-4,4'-diol Usage And Synthesis |
| | 3,3',5,5'-Tetrakis(MethoxyMethyl)-[1,1'-biphenyl]-4,4'-diol Preparation Products And Raw materials |
|