|
|
| | 1-(2-Chloro-6-Methoxyphenyl)ethanone Basic information |
| Product Name: | 1-(2-Chloro-6-Methoxyphenyl)ethanone | | Synonyms: | 1-(2-Chloro-6-Methoxyphenyl)ethanone;1-(2-chloro-6-methoxyphenyl)ethan-1-one;1-(2-chloro-6-methoxylphenyl)ethanone;2'-Chloro-6'-methoxyacetophenone;Ethanone, 1-(2-chloro-6-methoxyphenyl)-;6’-Chloro-2’-methoxyacetophenone | | CAS: | 881883-32-5 | | MF: | C9H9ClO2 | | MW: | 184.62 | | EINECS: | | | Product Categories: | | | Mol File: | 881883-32-5.mol |  |
| | 1-(2-Chloro-6-Methoxyphenyl)ethanone Chemical Properties |
| storage temp. | Inert atmosphere,Room Temperature | | Appearance | Colorless to light brown Liquid | | InChI | InChI=1S/C9H9ClO2/c1-6(11)9-7(10)4-3-5-8(9)12-2/h3-5H,1-2H3 | | InChIKey | BTNKHLHHSHJZHD-UHFFFAOYSA-N | | SMILES | C(=O)(C1=C(OC)C=CC=C1Cl)C |
| | 1-(2-Chloro-6-Methoxyphenyl)ethanone Usage And Synthesis |
| | 1-(2-Chloro-6-Methoxyphenyl)ethanone Preparation Products And Raw materials |
|