|
|
| | Indeno[1,2-b]fluorene-6,12-dione, 2,8-dibroMo- Basic information |
| Product Name: | Indeno[1,2-b]fluorene-6,12-dione, 2,8-dibroMo- | | Synonyms: | Indeno[1,2-b]fluorene-6,12-dione, 2,8-dibroMo-;2,8-Dibromoindeno[1,2-b]fluorene-6,12-dione>2,8-Dibromindeno [1,2-b] fluoren-6,12-dione | | CAS: | 853234-57-8 | | MF: | C20H8Br2O2 | | MW: | 440.08 | | EINECS: | | | Product Categories: | | | Mol File: | 853234-57-8.mol | ![Indeno[1,2-b]fluorene-6,12-dione, 2,8-dibroMo- Structure](CAS/20150408/GIF/853234-57-8.gif) |
| | Indeno[1,2-b]fluorene-6,12-dione, 2,8-dibroMo- Chemical Properties |
| Melting point | >390 °C | | Boiling point | 634.0±55.0 °C(Predicted) | | density | 1.892±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | form | powder to crystal | | color | Orange to Brown to Dark red | | InChI | InChI=1S/C20H8Br2O2/c21-9-1-3-11-13-7-18-14(8-17(13)19(23)15(11)5-9)12-4-2-10(22)6-16(12)20(18)24/h1-8H | | InChIKey | PFFSYBJLQOJRQU-UHFFFAOYSA-N | | SMILES | C1(=O)C2=C(C=CC(Br)=C2)C2=C1C=C1C3=C(C=C(Br)C=C3)C(=O)C1=C2 |
| | Indeno[1,2-b]fluorene-6,12-dione, 2,8-dibroMo- Usage And Synthesis |
| Chemical Properties | red powder |
| | Indeno[1,2-b]fluorene-6,12-dione, 2,8-dibroMo- Preparation Products And Raw materials |
|