- Thalifendine
-
- $1428.00
-
2026-05-11
- CAS:18207-71-1
- Purity: 99.82%
- Supply Ability: 10g
|
| | Thalifendine Basic information |
| Product Name: | Thalifendine | | Synonyms: | 10-hydroxy-9-methoxy-5,6-dihydro[1,3]dioxolo[4,5-g]isoquino[3,2-a]isoquinolin-7-ium;10-hydroxy-9-methoxy-5,6-dihydro-[1,3]dioxolo[4,5-g]isoquinolino[3,2-a]isoquinolin-7-ium;Thalifendine | | CAS: | 18207-71-1 | | MF: | C19H16NO4+ | | MW: | 322.33464 | | EINECS: | | | Product Categories: | | | Mol File: | 18207-71-1.mol |  |
| | Thalifendine Chemical Properties |
| Melting point | >230 °C | | InChI | InChI=1S/C19H15NO4/c1-22-19-14-9-20-5-4-12-7-17-18(24-10-23-17)8-13(12)15(20)6-11(14)2-3-16(19)21/h2-3,6-9H,4-5,10H2,1H3/p+1 | | InChIKey | OEGWOBMNQDATKP-UHFFFAOYSA-O | | SMILES | O1C([H])([H])OC2=C1C([H])=C1C(=C2[H])C2C([H])=C3C([H])=C([H])C(=C(C3=C([H])[N+]=2C([H])([H])C1([H])[H])OC([H])([H])[H])O[H] |
| | Thalifendine Usage And Synthesis |
| Description | A quaternary alkaloid present in Thalictrum fendleri Engelm., the base is isolated
as the chloride which forms yellow crystals, sintering above 230° C. The ultra violet spectrum of this salt has absorption maxima at 231, 269 and 348 TllJ.l. The
structure is similar to that of thalidastine (q.v.). | | References | Shamma, Greenberg, Dudock., Tetrahedron Lett., 3595 (1965) |
| | Thalifendine Preparation Products And Raw materials |
|