|
|
| | Methyl 5-Methyl-1H-pyrrole-2-carboxylate Basic information |
| Product Name: | Methyl 5-Methyl-1H-pyrrole-2-carboxylate | | Synonyms: | Methyl 5-Methyl-1H-pyrrole-2-carboxylate;1H-Pyrrole-2-carboxylicacid, 5-methyl-, methyl ester;5-methyl-1H-Pyrrole-2-carboxylic acid methyl ester;Methyl 5-Methyl-2-pyrrolecarboxylate;Methyl 5-methyl-1H-pyrrol-2-carboxylate;5-methylpyridine-2-methyl formate | | CAS: | 1194-97-4 | | MF: | C7H9NO2 | | MW: | 139.15 | | EINECS: | | | Product Categories: | | | Mol File: | 1194-97-4.mol |  |
| | Methyl 5-Methyl-1H-pyrrole-2-carboxylate Chemical Properties |
| Melting point | 93-94 °C | | Boiling point | 250.2±20.0 °C(Predicted) | | density | 1.141±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | pka | 15.89±0.50(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C7H9NO2/c1-5-3-4-6(8-5)7(9)10-2/h3-4,8H,1-2H3 | | InChIKey | CQYALQAMQXUBRO-UHFFFAOYSA-N | | SMILES | N1C(C)=CC=C1C(OC)=O |
| | Methyl 5-Methyl-1H-pyrrole-2-carboxylate Usage And Synthesis |
| Uses | 5-Methyl-2-(methoxycarbonyl)pyrrole is one of the chemical compounds detected from smoke condensate of 70mm nonfiltered cigarettes. |
| | Methyl 5-Methyl-1H-pyrrole-2-carboxylate Preparation Products And Raw materials |
|