| Company Name: |
TOSUN PHARM |
| Tel: |
020-66392521-118 18922260391 |
| Email: |
3004261881@qq.com |
|
| | (S)-5-Methoxy-N-propyl-N-(2-(thiophen-2-yl)ethyl)-1,2,3,4-tetrahydronaphthalen-2-aMine Basic information |
| Product Name: | (S)-5-Methoxy-N-propyl-N-(2-(thiophen-2-yl)ethyl)-1,2,3,4-tetrahydronaphthalen-2-aMine | | Synonyms: | (2S)-5-methoxy-N-propyl-N-(2-thiophen-2-ylethyl)-1,2,3,4-tetrahydronaphthalen-2-amine;Rotigotine USP RC H;(S)-5-methoxy-N-propyl-N-(2'-(thien-2-yl-)ethyl)-tetralin-2-amine;(S)-5-Methoxy-N-propyl-N-(2-(thiophen-2-yl)ethyl)-1,2,3,4-tetrahydronaphthalen-2-aMine;Rotigotine USP Related Compound H;Rotigotine Impurity 5（Rotigotine USP RC H）;2-Thiopheneethanamine, N-propyl-N-[(2S)-1,2,3,4-tetrahydro-5-methoxy-2-naphthalenyl]-;5’-Deshydroxy-5’-methoxy Rotigotine | | CAS: | 1148154-91-9 | | MF: | C20H27NOS | | MW: | 329.5 | | EINECS: | | | Product Categories: | | | Mol File: | 1148154-91-9.mol |  |
| | (S)-5-Methoxy-N-propyl-N-(2-(thiophen-2-yl)ethyl)-1,2,3,4-tetrahydronaphthalen-2-aMine Chemical Properties |
| Boiling point | 473.5±45.0 °C(Predicted) | | density | 1.10±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | 8.92±0.20(Predicted) | | Major Application | pharmaceutical | | InChI | 1S/C20H27NOS/c1-3-12-21(13-11-18-7-5-14-23-18)17-9-10-19-16(15-17)6-4-8-20(19)22-2/h4-8,14,17H,3,9-13,15H2,1-2H3/t17-/m0/s1 | | InChIKey | AXOQYAWBBDSEMG-KRWDZBQOSA-N | | SMILES | [s]1c(ccc1)CCN([C@H]2CCc3c(cccc3OC)C2)CCC |
| WGK Germany | WGK 3 | | HS Code | 2934990002 | | Storage Class | 10 - Combustible liquids |
| | (S)-5-Methoxy-N-propyl-N-(2-(thiophen-2-yl)ethyl)-1,2,3,4-tetrahydronaphthalen-2-aMine Usage And Synthesis |
| Uses | 5’-Deshydroxy-5’-methoxy Rotigotine is an impurity of Rotigotine (R700700). Rotigotine is a non-ergot dopamine agonist drug and is indicated for the treatment of Parkinson’s disease. |
| | (S)-5-Methoxy-N-propyl-N-(2-(thiophen-2-yl)ethyl)-1,2,3,4-tetrahydronaphthalen-2-aMine Preparation Products And Raw materials |
|