|
|
| | [(2,6-DiMethylphenyl)aMino](oxo)acetic Acid Basic information |
| Product Name: | [(2,6-DiMethylphenyl)aMino](oxo)acetic Acid | | Synonyms: | [(2,6-DiMethylphenyl)aMino](oxo)acetic Acid;2-((2,6-diMethylphenyl)aMino)-2-oxoacetic acid;2,6-Dimethylanilino(oxo)acetic acid;DMPAO;2-METHYL-2-PROPANYL (3-FLUORO-4-METHYLPHENYL)CARBAMATE;[(2,6-DIMETHYLPHENYL)CARBAMOYL]FORMIC ACID;[(2,6-Dimethylphenyl)amino](oxo)aceticAcid>Acetic acid, 2-[(2,6-dimethylphenyl)amino]-2-oxo- | | CAS: | 2903-48-2 | | MF: | C10H11NO3 | | MW: | 193.2 | | EINECS: | | | Product Categories: | | | Mol File: | 2903-48-2.mol | acetic Acid Structure](CAS/20150408/GIF/2903-48-2.gif) |
| | [(2,6-DiMethylphenyl)aMino](oxo)acetic Acid Chemical Properties |
| Melting point | 178-180 °C | | density | 1.290±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | pka | 0.12±0.54(Predicted) | | form | powder | | color | White to Almost white | | InChI | 1S/C10H11NO3/c1-6-4-3-5-7(2)8(6)11-9(12)10(13)14/h3-5H,1-2H3,(H,11,12)(H,13,14) | | InChIKey | JFTAPSBIODPQJN-UHFFFAOYSA-N | | SMILES | O=C(C(O)=O)NC1=C(C)C=CC=C1C |
| WGK Germany | WGK 3 | | HS Code | 2922498590 | | Storage Class | 11 - Combustible Solids |
| | [(2,6-DiMethylphenyl)aMino](oxo)acetic Acid Usage And Synthesis |
| Chemical Properties | White Crystalline Powder | | reaction suitability | core: palladium reaction type: Buchwald-Hartwig Cross Coupling Reaction reaction type: Heck Reaction reaction type: Hiyama Coupling reaction type: Negishi Coupling reaction type: Sonogashira Coupling reaction type: Stille Coupling reaction type: Suzuki-Miyaura Coupling reagent type: catalyst |
| | [(2,6-DiMethylphenyl)aMino](oxo)acetic Acid Preparation Products And Raw materials |
|