|
|
| | 5-Chloro-2-nitrobenzonitrile Basic information |
| | 5-Chloro-2-nitrobenzonitrile Chemical Properties |
| Melting point | 89-91 °C(lit.) | | Boiling point | 120°C/20mmHg(lit.) | | density | 1.6133 (rough estimate) | | refractive index | 1.5557 (estimate) | | storage temp. | Store at room temperature | | form | solid | | Appearance | Light brown to brown Solid | | InChI | 1S/C7H3ClN2O2/c8-6-1-2-7(10(11)12)5(3-6)4-9/h1-3H | | InChIKey | HPWJUEZFOUOUEO-UHFFFAOYSA-N | | SMILES | [O-][N+](=O)c1ccc(Cl)cc1C#N | | CAS DataBase Reference | 34662-31-2(CAS DataBase Reference) | | NIST Chemistry Reference | Benzonitrile, 5-chloro-2-nitro-(34662-31-2) |
| Hazard Codes | Xn,Xi | | Risk Statements | 20/21/22-36/37/38 | | Safety Statements | 26-37/39-36 | | WGK Germany | 3 | | HS Code | 2926907090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Dermal
Acute Tox. 4 Inhalation
Acute Tox. 4 Oral
Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 5-Chloro-2-nitrobenzonitrile Usage And Synthesis |
| Chemical Properties | light yellow to yellow-brown crystalline needles | | Uses | 5-Chloro-2-nitrobenzonitrile has been used in the preparation of a series of 2,4-diamino-6-[(aralkyl and alicyclic)thio-, sulfinyl-, and sulfonyl]quinazolines by condensation reaction. |
| | 5-Chloro-2-nitrobenzonitrile Preparation Products And Raw materials |
|