|
|
| | 1,4-Benzenedicarboxaldehyde, 2,3-diMethoxy- (Related Reference) Basic information |
| Product Name: | 1,4-Benzenedicarboxaldehyde, 2,3-diMethoxy- (Related Reference) | | Synonyms: | 1,4-Benzenedicarboxaldehyde, 2,3-diMethoxy- (Related Reference);1,4-Benzenedicarboxaldehyde, 2,3-dimethoxy-;2,3-Dimethoxy-1,4-benzenedicarboxaldehyde;1,4-diformyl-2,3-dimethoxybenzene;2,3-dimethoxy-1,4-benzenedimethylaldehyde;2,3-Dimethoxyterephthalaldehyde | | CAS: | 179693-85-7 | | MF: | C10H10O4 | | MW: | 194.18 | | EINECS: | | | Product Categories: | | | Mol File: | 179693-85-7.mol |  |
| | 1,4-Benzenedicarboxaldehyde, 2,3-diMethoxy- (Related Reference) Chemical Properties |
| Melting point | 99.5-100.5 °C | | Boiling point | 365.0±42.0 °C(Predicted) | | density | 1+-.0.06 g/cm3(Predicted) | | storage temp. | 2-8°C, stored under nitrogen | | Appearance | Light yellow to yellow Solid | | InChI | InChI=1S/C10H10O4/c1-13-9-7(5-11)3-4-8(6-12)10(9)14-2/h3-6H,1-2H3 | | InChIKey | WAHBFHUZSTXBMP-UHFFFAOYSA-N | | SMILES | C1(C=O)=CC=C(C=O)C(OC)=C1OC |
| | 1,4-Benzenedicarboxaldehyde, 2,3-diMethoxy- (Related Reference) Usage And Synthesis |
| Uses | Used as a monomer for the synthesis of COF materials: COF-Tz-OH. | | Synthesis Reference(s) | Journal of Medicinal Chemistry, 44, p. 1396, 2001 DOI: 10.1021/jm000107x |
| | 1,4-Benzenedicarboxaldehyde, 2,3-diMethoxy- (Related Reference) Preparation Products And Raw materials |
|