| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
SIMAGCHEM CORP |
| Tel: |
+86-5922680277 +86-13806087780 |
| Email: |
sale@simagchem.com |
|
| | Bisphenol F ethoxylate (2 eo/phenol) diacrylate Basic information |
| | Bisphenol F ethoxylate (2 eo/phenol) diacrylate Chemical Properties |
| density | 1.15 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.541(lit.) | | Fp | 230 °F | | storage temp. | 2-8°C | | InChI | 1S/C13H12O2.C3H4O2.C2H6O2/c14-12-5-1-10(2-6-12)9-11-3-7-13(15)8-4-11;1-2-3(4)5;3-1-2-4/h1-8,14-15H,9H2;2H,1H2,(H,4,5);3-4H,1-2H2 | | InChIKey | OTXNLBPVRKDFKX-UHFFFAOYSA-N | | SMILES | OCCO.OC(=O)C=C.Oc1ccc(Cc2ccc(O)cc2)cc1 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38-43 | | Safety Statements | 26-36/37 | | WGK Germany | 3 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 STOT SE 3 |
| | Bisphenol F ethoxylate (2 eo/phenol) diacrylate Usage And Synthesis |
| | Bisphenol F ethoxylate (2 eo/phenol) diacrylate Preparation Products And Raw materials |
|