|
|
| | 3-(4-Bromophenyl)oxetane Basic information |
| | 3-(4-Bromophenyl)oxetane Chemical Properties |
| Boiling point | 268.8±28.0 °C(Predicted) | | density | 1.496±0.06 g/cm3(Predicted) | | storage temp. | Storage temp. 2-8°C | | Appearance | Colorless to off-white Solid-Liquid Mixture | | InChI | InChI=1S/C9H9BrO/c10-9-3-1-7(2-4-9)8-5-11-6-8/h1-4,8H,5-6H2 | | InChIKey | NASAZXLCAPUVRH-UHFFFAOYSA-N | | SMILES | O1CC(C2=CC=C(Br)C=C2)C1 |
| | 3-(4-Bromophenyl)oxetane Usage And Synthesis |
| Uses | 3-(4-Bromophenyl)oxetane is used in preparation of heteroaromtic compounds useful as antibacterial agents. |
| | 3-(4-Bromophenyl)oxetane Preparation Products And Raw materials |
|