|
|
| | diethyl 4-vinylbenzylphosphonate Basic information |
| Product Name: | diethyl 4-vinylbenzylphosphonate | | Synonyms: | Phosphonic acid, [(4-ethenylphenyl)methyl]-, diethyl ester;4-Vinylbenzylphosphonic acid diethyl ester;diethyl 4-vinylbenzylphosphonate;Diethyl (p-Vinylbenzyl)phosphonate;Phosphonic acid, P-[(4-ethenylphenyl)methyl]-, diethyl ester | | CAS: | 726-61-4 | | MF: | C13H19O3P | | MW: | 254.26 | | EINECS: | | | Product Categories: | Chloromethy styrene | | Mol File: | 726-61-4.mol |  |
| | diethyl 4-vinylbenzylphosphonate Chemical Properties |
| Boiling point | 120 °C(Press: 0.2 Torr) | | density | 1.083±0.06 g/cm3(Predicted) | | InChI | InChI=1S/C13H19O3P/c1-4-12-7-9-13(10-8-12)11-17(14,15-5-2)16-6-3/h4,7-10H,1,5-6,11H2,2-3H3 | | InChIKey | UURKSQXMUNUXSI-UHFFFAOYSA-N | | SMILES | P(CC1=CC=C(C=C)C=C1)(=O)(OCC)OCC |
| | diethyl 4-vinylbenzylphosphonate Usage And Synthesis |
| | diethyl 4-vinylbenzylphosphonate Preparation Products And Raw materials |
|