|
|
| | 1,4-Bis-(2-broMo-ethoxy)-benzene Basic information |
| Product Name: | 1,4-Bis-(2-broMo-ethoxy)-benzene | | Synonyms: | Benzene,1,4-bis(2-bromoethoxy)-;1,4-Bis-(2-broMo-ethoxy)-benzene;1,4-di(2-broMoethoxy)benzene;1,4-bis(bromoethoxy)benzene;1,1-dibromo-p-phenyldiethyl ether;1,4-Bis(2-bromoethoxy)benzene - [B71311] | | CAS: | 5471-84-1 | | MF: | C10H12Br2O2 | | MW: | 324.01 | | EINECS: | | | Product Categories: | | | Mol File: | 5471-84-1.mol |  |
| | 1,4-Bis-(2-broMo-ethoxy)-benzene Chemical Properties |
| Melting point | 114 °C | | Boiling point | 145-147 °C(Press: 2 Torr) | | density | 1.646±0.06 g/cm3(Predicted) | | storage temp. | Store at room temperature | | Appearance | White to off-white Solid | | InChI | InChI=1S/C10H12Br2O2/c11-5-7-13-9-1-2-10(4-3-9)14-8-6-12/h1-4H,5-8H2 | | InChIKey | ATALLSGKFZVRKF-UHFFFAOYSA-N | | SMILES | C1(OCCBr)=CC=C(OCCBr)C=C1 |
| | 1,4-Bis-(2-broMo-ethoxy)-benzene Usage And Synthesis |
| Uses | 1,4-Bis(2-bromoethoxy)benzene is used in the preparation of liquid-crystalline pillar[5]- and pillar[6]arene. |
| | 1,4-Bis-(2-broMo-ethoxy)-benzene Preparation Products And Raw materials |
|