|
|
| | 1,3-dichloro-5-(3,3,3-trifluoroprop-1-en-2-yl)benzene Basic information |
| Product Name: | 1,3-dichloro-5-(3,3,3-trifluoroprop-1-en-2-yl)benzene | | Synonyms: | 1,3-dichloro-5-(3,3,3-trifluoroprop-1-en-2-yl)benzene;1,3-dichloro-5-[1-(trifluoromethyl)ethenyl]benzene;1,3-dichloro-5-(1,1,1-trifluoroprop-2-en-2-yl)benzene;Benzene, 1,3-dichloro-5-[1-(trifluoromethyl)ethenyl]-;Fluralaner Related Compound 1;Fluralaner-041;1,3-Dichloro-5-(3,3,3-trifluoroprop-1-en-2-yl)benzene(FluralanerImpurity);1,3- dichloro -5-[1- (trifluoromethyl) vinyl] benzene | | CAS: | 864725-22-4 | | MF: | C9H5Cl2F3 | | MW: | 241.04 | | EINECS: | | | Product Categories: | | | Mol File: | 864725-22-4.mol |  |
| | 1,3-dichloro-5-(3,3,3-trifluoroprop-1-en-2-yl)benzene Chemical Properties |
| Boiling point | 265.6±40.0 °C(Predicted) | | density | 1.373±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | Appearance | Colorless to light yellow Liquid | | InChI | InChI=1S/C9H5Cl2F3/c1-5(9(12,13)14)6-2-7(10)4-8(11)3-6/h2-4H,1H2 | | InChIKey | UYBQBUZXULIDMQ-UHFFFAOYSA-N | | SMILES | C1(Cl)=CC(C(C(F)(F)F)=C)=CC(Cl)=C1 |
| | 1,3-dichloro-5-(3,3,3-trifluoroprop-1-en-2-yl)benzene Usage And Synthesis |
| | 1,3-dichloro-5-(3,3,3-trifluoroprop-1-en-2-yl)benzene Preparation Products And Raw materials |
|