- m-PEG8-amido-Mal
-
-
2025-06-07
- CAS:1334169-90-2
- Min. Order: 1g
- Purity: >98.00%
- Supply Ability: 1g
|
| | MPEG8-NH-Mal Basic information |
| Product Name: | MPEG8-NH-Mal | | Synonyms: | m-PEG8-Mal;mPEG8-Maleimide;m-dPEG(R)8-MAL;MPEG8-NH-Mal;Mal-amido-PEG8-Ome;1H-Pyrrole-1-propanamide, 2,5-dihydro-N-3,6,9,12,15,18,21,24-octaoxapentacos-1-yl-2,5-dioxo-;m-dPEG8-MAL;m-PEG8-amido-Mal | | CAS: | 1334169-90-2 | | MF: | C24H42N2O11 | | MW: | 534.6 | | EINECS: | | | Product Categories: | peg | | Mol File: | 1334169-90-2.mol |  |
| | MPEG8-NH-Mal Chemical Properties |
| storage temp. | -20°C | | form | solid or viscous liquid | | InChI | 1S/C24H42N2O11/c1-30-8-9-32-12-13-34-16-17-36-20-21-37-19-18-35-15-14-33-11-10-31-7-5-25-22(27)4-6-26-23(28)2-3-24(26)29/h2-3H,4-21H2,1H3,(H,25,27) | | InChIKey | DYKKRMSENAYADQ-UHFFFAOYSA-N | | SMILES | COCCOCCOCCOCCOCCOCCOCCOCCNC(CCN1C(C=CC1=O)=O)=O |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | MPEG8-NH-Mal Usage And Synthesis |
| Description | m-PEG8-Mal is a PEG linker containing a maleimide group. The maleimide group will react with a thiol group to form a covalent bond, enabling the connection of biomolecule with a thiol. The hydrophilic PEG spacer increases solubility in aqueous media. | | Uses | m-PEG8-Mal is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. | | reaction suitability | reactivity: thiol reactive
reagent type: chemical modification reagent
reagent type: cross-linking reagent
reactivity: sulfhydryl reactive | | IC 50 | PEGs | | References | [1] An S, et al. Small-molecule PROTACs: An emerging and promising approach for the development of targeted therapy drugs. EBioMedicine. 2018 Oct;36:553-562 DOI:10.1016/j.ebiom.2018.09.005 |
| | MPEG8-NH-Mal Preparation Products And Raw materials |
|