2-(4-Methylphenyl)sulfonyloxyethanol manufacturers
- OH-PEG1-Tos
-
- $0.00 / 1g
-
2026-02-05
- CAS:42772-85-0
- Min. Order: 1g
- Purity: 98%
- Supply Ability: 1g/bottle, 10g/bottle, 100g/bottle
- OH-PEG1-Tos
-
- $0.00 / 5g
-
2025-06-07
- CAS:42772-85-0
- Min. Order: 5g
- Purity: >98.00%
- Supply Ability: 5g
|
| | 2-(4-Methylphenyl)sulfonyloxyethanol Basic information |
| Product Name: | 2-(4-Methylphenyl)sulfonyloxyethanol | | Synonyms: | 2-(4-Methylphenyl)sulfonyloxyethanol;2-HYDROXYETHYL 4-METHYLBENZENESULFONATE;Theophylline Impurity 9;1,2-Ethanediol, 1-(4-methylbenzenesulfonate);2-[(4-Methylbenzenesulfonyl)oxy]ethan-1-ol;2-Hydroxyethyl-4-methyl benzene sulphonate;OH-PEG1-Tos; Doxofylline Impurity 26 | | CAS: | 42772-85-0 | | MF: | C9H12O4S | | MW: | 216.25 | | EINECS: | | | Product Categories: | | | Mol File: | 42772-85-0.mol |  |
| | 2-(4-Methylphenyl)sulfonyloxyethanol Chemical Properties |
| Melting point | 135-136 °C | | Boiling point | 376.8±25.0 °C(Predicted) | | density | 1.278 g/cm3 | | storage temp. | Storage temp. 2-8°C | | pka | 13.76±0.10(Predicted) | | Appearance | Colorless to light yellow Liquid | | InChI | InChI=1S/C9H12O4S/c1-8-2-4-9(5-3-8)14(11,12)13-7-6-10/h2-5,10H,6-7H2,1H3 | | InChIKey | DZVSAHOHDQUFMZ-UHFFFAOYSA-N | | SMILES | C(OS(C1=CC=C(C)C=C1)(=O)=O)CO |
| | 2-(4-Methylphenyl)sulfonyloxyethanol Usage And Synthesis |
| | 2-(4-Methylphenyl)sulfonyloxyethanol Preparation Products And Raw materials |
|