| Company Name: |
T&W GROUP |
| Tel: |
021-61551611 13296011611 |
| Email: |
contact@trustwe.com |
|
| | 9-Azabicyclo[3.3.1]nonane N-oxyl Basic information |
| Product Name: | 9-Azabicyclo[3.3.1]nonane N-oxyl | | Synonyms: | NPPN;9-Azabicyclo[3.3.1]nonane N-oxyl;9-Azabicyclo[3.3.1]nonane N-oxyl 95%;exe-3-methylamino-9-boc -9-azabicyclo[3.3.1]nonane;9-AZABICYCLO[3.3.1]NONANE N-OX;9-Azabicyclo[3.3.1]non-9-yloxy;9-azabicyclo[3.3.1]nonan-9-ol;9-hydroxy-9-azabicyclo[3.3.1]nonane | | CAS: | 31785-68-9 | | MF: | C8H14NO* | | MW: | 140.20286 | | EINECS: | 803-697-7 | | Product Categories: | | | Mol File: | 31785-68-9.mol | ![9-Azabicyclo[3.3.1]nonane N-oxyl Structure](CAS/20150408/GIF/31785-68-9.gif) |
| | 9-Azabicyclo[3.3.1]nonane N-oxyl Chemical Properties |
| Melting point | 65-70°C | | storage temp. | 2-8°C | | form | solid | | Appearance | Brown to reddish brown Solid | | BRN | 1681761 | | InChI | InChI=1S/C8H14NO/c10-9-7-3-1-4-8(9)6-2-5-7/h7-8H,1-6H2 | | InChIKey | SZAKAAGHPLUEPM-UHFFFAOYSA-N | | SMILES | C12N([O])C(CCC1)CCC2 |^1:2| |
| Hazard Codes | Xn | | Risk Statements | 22-41-52/53 | | Safety Statements | 26-39-61 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 |
| | 9-Azabicyclo[3.3.1]nonane N-oxyl Usage And Synthesis |
| Uses | 9-Azabicyclo[3.3.1]nonane N-oxyl (ABNO) may be employed for the aerobic oxidation of alcohols. | | General Description | 9-Azabicyclo[3.3.1]nonane N-oxyl (ABNO) belongs to a sterically unhindered and stable class of nitroxyl radicals. It efficiently catalyzes the oxidation of alcohols to afford the corresponding carbonyl compounds. ABNO along with (MeObpy)CuI(OTf) (MeObpy =4,4′-dimethoxy-2,2′-bipyridine) comprises a catalytic system. This catalytic system is useful for the aerobic oxidation of all categories of alcohols. | | reaction suitability | reagent type: ligand | | Synthesis | 1. 9-Benzyl-9-azabicyclononan-3-one is reduced to 9-benzyl-9-azabicyclononane in a continuous reactor at 215C with KOH/hydrazine hydrate/ethanol. 2. The product from step 1 is hydrogenated in methanol with Pd/C to remove the benzyl group, yielding 9-azabicyclononane. 3. The product from step 2 is oxidized with urea peroxide catalyzed by sodium tungstate to give the N-oxyl radical. |
| | 9-Azabicyclo[3.3.1]nonane N-oxyl Preparation Products And Raw materials |
|