| Company Name: |
Accela ChemBio Inc. |
| Tel: |
+1-858-6993322 +86-18019713315 |
| Email: |
info@accelachem.com |
|
| | tert-Butyl (2-Methylthiazol-4-yl)carbaMate Basic information |
| Product Name: | tert-Butyl (2-Methylthiazol-4-yl)carbaMate | | Synonyms: | tert-Butyl (2-Methylthiazol-4-yl)carbaMate;tert-butyl N-(2-methyl-1,3-thiazol-4-yl)carbamate;4-(Boc-amino)-2-methylthiazole;Carbamic acid, N-(2-methyl-4-thiazolyl)-, 1,1-dimethylethyl ester;tert-butyl N-(2-methylthiazol-4-yl)carbamate;(2-methylthiazole-4-yl)aminomacetic acidtertbutyl ester | | CAS: | 848472-61-7 | | MF: | C9H14N2O2S | | MW: | 214.28 | | EINECS: | | | Product Categories: | | | Mol File: | 848472-61-7.mol |  |
| | tert-Butyl (2-Methylthiazol-4-yl)carbaMate Chemical Properties |
| storage temp. | 2-8°C | | InChI | InChI=1S/C9H14N2O2S/c1-6-10-7(5-14-6)11-8(12)13-9(2,3)4/h5H,1-4H3,(H,11,12) | | InChIKey | NNWHAYYMOHDJME-UHFFFAOYSA-N | | SMILES | C(OC(C)(C)C)(=O)NC1=CSC(C)=N1 |
| | tert-Butyl (2-Methylthiazol-4-yl)carbaMate Usage And Synthesis |
| | tert-Butyl (2-Methylthiazol-4-yl)carbaMate Preparation Products And Raw materials |
|