|
|
| | Pregn-4-ene-3,20-dione,11,17-dihydroxy-, (11a)- Basic information |
| Product Name: | Pregn-4-ene-3,20-dione,11,17-dihydroxy-, (11a)- | | Synonyms: | Pregn-4-ene-3,20-dione,11,17-dihydroxy-, (11a)-;11a,17a-Dihydroxy-4-pregnene-3,20-dione;11a,17a-Dihydroxyprogesterone;Pregn-4-ene-3,20-dione, 11,17-dihydroxy-, (11α)-;11α,17α-Dihydroxyprogesterone;11α,17α-Dihydroxy-4-pregnene-3,20-dione;11α,17α-Dihydroxy-4-prenene-3,20-dione;4-PREGNEN-11α, 17α-DIOL-3-ONE | | CAS: | 603-98-5 | | MF: | C21H30O4 | | MW: | 346.46 | | EINECS: | 200-001-8 | | Product Categories: | 603-98-5 | | Mol File: | 603-98-5.mol |  |
| | Pregn-4-ene-3,20-dione,11,17-dihydroxy-, (11a)- Chemical Properties |
| Melting point | 216-218 °C | | Boiling point | 523.9±50.0 °C(Predicted) | | density | 1.21±0.1 g/cm3(Predicted) | | pka | 12.86±0.70(Predicted) | | InChI | InChI=1/C21H30O4/c1-12(22)21(25)9-7-16-15-5-4-13-10-14(23)6-8-19(13,2)18(15)17(24)11-20(16,21)3/h10,15-18,24-25H,4-9,11H2,1-3H3/t15-,16-,17+,18+,19-,20-,21-/s3 | | InChIKey | LCZBQMKVFQNSJR-MXBJKANSNA-N | | SMILES | C1(=O)C=C2[C@](C)(CC1)[C@]1([H])[C@]([H])([C@@]3([H])[C@@](C[C@H]1O)(C)[C@@](O)(C(=O)C)CC3)CC2 |&1:4,8,10,12,14,16,19,r| |
| | Pregn-4-ene-3,20-dione,11,17-dihydroxy-, (11a)- Usage And Synthesis |
| Uses | (11α)-11,17-Dihydroxypregn-4-ene-3,20-dione is a dihydroxyl product of progesterone by three species of the genus Humicola;Also, it is derived from 11α-Hydroxy Progesterone (H952335), which is a Progesterone (P755900) metabolite. |
| | Pregn-4-ene-3,20-dione,11,17-dihydroxy-, (11a)- Preparation Products And Raw materials |
|