|
|
| | [S-(R*,R*)]-1-[1-oxo-2-(3,4,5-trimethoxyphenyl)butyl]-2-piperdinecarboxylic acid Basic information |
| Product Name: | [S-(R*,R*)]-1-[1-oxo-2-(3,4,5-trimethoxyphenyl)butyl]-2-piperdinecarboxylic acid | | Synonyms: | [S-(R*,R*)]-1-[1-oxo-2-(3,4,5-trimethoxyphenyl)butyl]-2-piperdinecarboxylic acid;(2R)-1-(2-(3,4,5-trimethoxyphenyl)butanoyl)piperidine-2-carboxylic acid;(S)-1-((S)-2-(3,4,5-Trimethoxyphenyl)butanoyl)piperidine-2-carboxylic Acid;2-Piperidinecarboxylic acid, 1-[(2S)-1-oxo-2-(3,4,5-trimethoxyphenyl)butyl]-, (2S)-;(S)-1-((S)-2-(3,4,5-Trimethoxyphenyl)butanoyl)piperidine-2-carboxylic acid - [T91342] | | CAS: | 195202-09-6 | | MF: | C19H27NO6 | | MW: | 365.42 | | EINECS: | | | Product Categories: | | | Mol File: | 195202-09-6.mol | ![[S-(R*,R*)]-1-[1-oxo-2-(3,4,5-trimethoxyphenyl)butyl]-2-piperdinecarboxylic acid Structure](CAS/20180703/GIF/195202-09-6.gif) |
| | [S-(R*,R*)]-1-[1-oxo-2-(3,4,5-trimethoxyphenyl)butyl]-2-piperdinecarboxylic acid Chemical Properties |
| Melting point | 176-178 °C | | Boiling point | 557.9±50.0 °C(Predicted) | | density | 1.188±0.06 g/cm3(Predicted) | | storage temp. | Storage temp. 2-8°C | | solubility | soluble in Ethyl Acetate | | pka | 3.55±0.20(Predicted) | | form | Solid | | color | White | | InChI | InChI=1S/C19H27NO6/c1-5-13(18(21)20-9-7-6-8-14(20)19(22)23)12-10-15(24-2)17(26-4)16(11-12)25-3/h10-11,13-14H,5-9H2,1-4H3,(H,22,23)/t13-,14-/m0/s1 | | InChIKey | QSLGUZZUFDIKSY-KBPBESRZSA-N | | SMILES | N1(C(=O)[C@H](C2=CC(OC)=C(OC)C(OC)=C2)CC)CCCC[C@H]1C(O)=O |
| | [S-(R*,R*)]-1-[1-oxo-2-(3,4,5-trimethoxyphenyl)butyl]-2-piperdinecarboxylic acid Usage And Synthesis |
| Uses | (S)-1-((S)-2-(3,4,5-Trimethoxyphenyl)butanoyl)piperidine-2-carboxylic Acid is an intermediate for the synthesis of dTAG-7 (D710015), which is a degradation tag, was tested for its efficiency at depleting FKBP12F36V -MELK(sg3R) and was found to have significantly degraded FKBP12F36V -MELK(sg3R) within 4 hours.Used in the study of cancer research. |
| | [S-(R*,R*)]-1-[1-oxo-2-(3,4,5-trimethoxyphenyl)butyl]-2-piperdinecarboxylic acid Preparation Products And Raw materials |
|