| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
Methyl-piperidino-pyrazole hydrate manufacturers
|
| | Methyl-piperidino-pyrazole hydrate Basic information |
| Product Name: | Methyl-piperidino-pyrazole hydrate | | Synonyms: | 1,3-Bis(4-hydroxyphenyl)-4-methyl-5-[4-(2-piperidinylethoxy)phenol]-1H-pyrazole dihydrochloride hydrate;Methyl-piperidino-pyrazole hydrate;Methyl-piperidino-pyrazole dihydrochloride hydrate;MPP dihydrochloride (289726029 Free base),MPP dihydrochloride (289726 02 9 Free base);4,4'-(4-Methyl-5-(4-(2-(piperidin-1-yl)ethoxy)phenyl)-1H-pyrazole-1,3-diyl)diphenol dihydrochloride;4,4'-(4-Methyl-5-(4-(2-(piperidin-1-yl)ethoxy)phenyl)-1H-pyrazole-1,3-diyl)diphenol dihydrochloride;MPP dihydrochloride hydrate | | CAS: | 911295-24-4 | | MF: | C29H32ClN3O3 | | MW: | 506.04 | | EINECS: | | | Product Categories: | | | Mol File: | 911295-24-4.mol |  |
| | Methyl-piperidino-pyrazole hydrate Chemical Properties |
| storage temp. | Store at -20°C | | solubility | DMSO: soluble ≥20mg/mL | | form | white powder | | color | White to off-white | | InChIKey | FWDNPWVVRVSJQH-UHFFFAOYSA-N | | SMILES | Cl.Cl.Cc1c(nn(-c2ccc(O)cc2)c1-c3ccc(OCCN4CCCCC4)cc3)-c5ccc(O)cc5 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | Methyl-piperidino-pyrazole hydrate Usage And Synthesis |
| Uses | MPP Dihydrochloride is a pharmacological estrogen receptor antagonist. It cannot block EE2 induced luciferase activity with any isoform of zebrafish estrogen receptor. | | Uses | MPP dihydrochloride hydrate has been used as an estrogen receptor α antagonist:
- in human breast cancer MCF-7 cells
- to pre-treat endometrial ex vivo organ cultures (EVOCs)
- to treat pituitary glands to monitor luteinizing hormone secretion
| | General Description | Methyl-piperidino-pyrazole hydrate (MPP) is prepared from a methyl-pyrazole-triol (MPT), a pyrazole triol. | | Biochem/physiol Actions | MPP dihydrochloride is a specific estrogen receptor α antagonist. | | storage | +4°C (desiccate) |
| | Methyl-piperidino-pyrazole hydrate Preparation Products And Raw materials |
|