| Company Name: |
TargetMol |
| Tel: |
400-821-0310 15002144251 |
| Email: |
xuexiang.shao@tsbiochem.com |
|
| | (4,5-Dihydro-3,5-diphenyl-1H-pyrazol-1-yl)-2-furanyl-methanone Basic information |
| | (4,5-Dihydro-3,5-diphenyl-1H-pyrazol-1-yl)-2-furanyl-methanone Chemical Properties |
| storage temp. | 2-8°C | | solubility | DMSO: ≥20mg/mL | | form | powder | | color | white to off-white | | InChI | 1S/C20H16N2O2/c23-20(19-12-7-13-24-19)22-18(16-10-5-2-6-11-16)14-17(21-22)15-8-3-1-4-9-15/h1-13,18H,14H2 | | InChIKey | VEIXLXIVAMCBLZ-UHFFFAOYSA-N | | SMILES | O=C(N1N=C(CC1c2ccccc2)c3ccccc3)c4ccco4 |
| Hazard Codes | T | | Risk Statements | 25 | | Safety Statements | 45 | | RIDADR | UN 2811 6.1 / PGIII | | WGK Germany | 3 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral Aquatic Chronic 4 |
| | (4,5-Dihydro-3,5-diphenyl-1H-pyrazol-1-yl)-2-furanyl-methanone Usage And Synthesis |
| Biological Activity | Rhodblock 1a is an inhibitor of the Rho Kinase pathway. |
| | (4,5-Dihydro-3,5-diphenyl-1H-pyrazol-1-yl)-2-furanyl-methanone Preparation Products And Raw materials |
|