| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
5-(11bS)-Dinaphtho[2,1-d:1′,2′-f][1,3,2]dioxaphosphepin-4-yl-5H-dibenz[b,f]azepine manufacturers
|
| | 5-(11bS)-Dinaphtho[2,1-d:1′,2′-f][1,3,2]dioxaphosphepin-4-yl-5H-dibenz[b,f]azepine Basic information | | Reaction |
| Product Name: | 5-(11bS)-Dinaphtho[2,1-d:1′,2′-f][1,3,2]dioxaphosphepin-4-yl-5H-dibenz[b,f]azepine | | Synonyms: | Reaxys ID: 21143615;(S)-(+)-N-(3,5-Dioxa-4-phosphacyclohepta[2,1-a;3,4-a']dinaphthalen-4-yl)-dibenzo[b,f]azepine >=95% (elemental analysis);3,4-a']dinaphthalen-4-yl)-5H-dibenz[b,f]azepine;3,4-a']dinaphthalen-4-yl)-5H-dibenz[b,f]azepine, min. 97%;(S)-(+)-(3,5-DIOXA-4-PHOSPHACYCLOHEPTA[2,1-A;3,4-A']DINAPHTHALEN-4-YL)-5H-DIBENZ[B,F]AZEPINE,MIN.97%;3,4-a']dinaphthalen-4-yl)-5H-dibenz[b,f]azepine,min.97%;(S)-(+)-(3,5-Dioxa-4-phosphacyclohepta[2,1-a:3,4-a']dinaphthalen-4-yl)-5H-dibenz[b,f]azepine, min. 97% | | CAS: | 942939-38-0 | | MF: | C34H22NO2P | | MW: | 507.53 | | EINECS: | | | Product Categories: | Chiral Phosphine;CPN | | Mol File: | 942939-38-0.mol | ![5-(11bS)-Dinaphtho[2,1-d:1′,2′-f][1,3,2]dioxaphosphepin-4-yl-5H-dibenz[b,f]azepine Structure](CAS/20180808/GIF/942939-38-0.gif) |
| | 5-(11bS)-Dinaphtho[2,1-d:1′,2′-f][1,3,2]dioxaphosphepin-4-yl-5H-dibenz[b,f]azepine Chemical Properties |
| Melting point | 246 °C | | Boiling point | 711.5±63.0 °C(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | pka | -2.70±0.20(Predicted) | | form | solid | | color | yellow | | Optical Rotation | 319.350°(C=1.0039g/100ml CHCL3) | | Sensitive | air sensitive, moisture sensitive | | InChI | 1S/C34H22NO2P/c1-5-13-27-23(9-1)19-21-31-33(27)34-28-14-6-2-10-24(28)20-22-32(34)37-38(36-31)35-29-15-7-3-11-25(29)17-18-26-12-4-8-16-30(26)35/h1-22H | | InChIKey | KOVOHCVLXRKTGN-UHFFFAOYSA-N | | SMILES | C1(C=CC=C2)=C2C(C3=C(C=CC=C4)C4=CC=C3OP5N6C7=C(C=CC=C7)C=CC8=C6C=CC=C8)=C(O5)C=C1 |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | 5-(11bS)-Dinaphtho[2,1-d:1′,2′-f][1,3,2]dioxaphosphepin-4-yl-5H-dibenz[b,f]azepine Usage And Synthesis |
| Reaction |
- The ligand is used in the stereodivergent α-allylation of linear aldehydes with dual iridium and amine catalysis.
- The ligand used in the direct, enantioselective iridium-catalyzed amination and (thio-) etherification of racemic allylic alcohols.
- The ligand used in an asymmetric, rhodium-catalyzed, intramolecular hydroacylation reaction.
| | Uses | Phosphorous precursor for ligand synthesis |
| | 5-(11bS)-Dinaphtho[2,1-d:1′,2′-f][1,3,2]dioxaphosphepin-4-yl-5H-dibenz[b,f]azepine Preparation Products And Raw materials |
|