| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | 2,5-Dichlorobenzenesulfonyl fluoride Basic information |
| | 2,5-Dichlorobenzenesulfonyl fluoride Chemical Properties |
| Boiling point | 284.3±30.0 °C(Predicted) | | density | 1.568 g/mL at 25 °C | | refractive index | n20/D1.540 | | Fp | >110℃ | | InChI | 1S/C6H3Cl2FO2S/c7-4-1-2-5(8)6(3-4)12(9,10)11/h1-3H | | InChIKey | RFKAVWPYSXFORB-UHFFFAOYSA-N | | SMILES | FS(C1=C(Cl)C=CC(Cl)=C1)(=O)=O |
| Hazard Codes | C | | Risk Statements | 34 | | Safety Statements | 26-36/37/39-45 | | RIDADR | UN 3265 8 / PGII | | WGK Germany | 3 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Eye Dam. 1
Skin Corr. 1B |
| | 2,5-Dichlorobenzenesulfonyl fluoride Usage And Synthesis |
| Uses | Sulfonyl fluoride motif can be used as a connector for the assembly of -SO2- linked small molecules with proteins or nucleic acids. This new click chemistry approach through sulfates is a complimentary approach to using amides and phosphate groups as linkers. | | General Description | 2,5-Dichlorobenzenesulfonyl fluoride is a halogenated aromatic sulfonyl fluoride. | | reaction suitability | reaction type: click chemistry |
| | 2,5-Dichlorobenzenesulfonyl fluoride Preparation Products And Raw materials |
|