| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
Domole Scientific |
| Tel: |
13275595566; 13275595566 |
| Email: |
domole@infsci.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
marketing1@energy-chemical.com |
Di(p-tolyl)iodonium triflate manufacturers
|
| | Di(p-tolyl)iodonium triflate Basic information |
| Product Name: | Di(p-tolyl)iodonium triflate | | Synonyms: | Bis(4-methylphenyl)iodonium triflate;Bis(4-methylphenyl)iodonium trifluoromethanesulfonate;Di(p-tolyl)iodonium triflate;Bis(4-methylphenyl)iodonium triflate >=98% (HPLC);Bis(4-methylphenyl)iodonium triflat | | CAS: | 123726-16-9 | | MF: | C15H14F3IO3S | | MW: | 458.2345396 | | EINECS: | | | Product Categories: | | | Mol File: | 123726-16-9.mol |  |
| | Di(p-tolyl)iodonium triflate Chemical Properties |
| form | powder | | BRN | 3583099 | | InChI | InChI=1S/C14H14I.CHF3O3S/c1-11-3-7-13(8-4-11)15-14-9-5-12(2)6-10-14;2-1(3,4)8(5,6)7/h3-10H,1-2H3;(H,5,6,7)/q+1;/p-1 | | InChIKey | CDEUHYARQIAHEG-UHFFFAOYSA-M | | SMILES | [I+](C1=CC=C(C)C=C1)C1=CC=C(C)C=C1.S(C(F)(F)F)([O-])(=O)=O |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | Di(p-tolyl)iodonium triflate Usage And Synthesis |
| reaction suitability | reagent type: oxidant |
| | Di(p-tolyl)iodonium triflate Preparation Products And Raw materials |
|