| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | 2-[2-[[(1,1-Dimethylethyl)dimethylsilyl]oxy]ethoxy]ethanamine Basic information |
| Product Name: | 2-[2-[[(1,1-Dimethylethyl)dimethylsilyl]oxy]ethoxy]ethanamine | | Synonyms: | 2-[2-(tert-Butyldimethylsilyloxy)ethoxy]ethanamine;2-[2-[[(1,1-Dimethylethyl)dimethylsilyl]oxy]ethoxy]ethanamine;2-[2-(tert-Butyldimethylsilyloxy)ethoxy]ethanamine 95%;Ethanamine, 2-[2-[[(1,1-dimethylethyl)dimethylsilyl]oxy]ethoxy]-;[2-(2-aminoethoxy)ethoxy](tert-butyl)dimethylsilane;2-[2-(tert-Butyldimethylsilyloxy)ethoxy]ethanamine;tert-Butyltrimethylsilane-PEG2-NH2;2-(2-((tert-butyldimethylsiliconalkaneyl)oxy)ethoxy)ethylamine | | CAS: | 215297-17-9 | | MF: | C10H25NO2Si | | MW: | 219.4 | | EINECS: | | | Product Categories: | | | Mol File: | 215297-17-9.mol | ![2-[2-[[(1,1-Dimethylethyl)dimethylsilyl]oxy]ethoxy]ethanamine Structure](CAS/20180703/GIF/215297-17-9.gif) |
| | 2-[2-[[(1,1-Dimethylethyl)dimethylsilyl]oxy]ethoxy]ethanamine Chemical Properties |
| Boiling point | 240.0±15.0 °C(Predicted) | | density | 0.887 g/mL at 25 °C | | refractive index | n20/D1.440 | | Fp | 101℃ | | storage temp. | 2-8°C | | pka | 8.74±0.10(Predicted) | | form | liquid | | InChI | 1S/C10H25NO2Si/c1-10(2,3)14(4,5)13-9-8-12-7-6-11/h6-9,11H2,1-5H3 | | InChIKey | BFDRSKJOABFLHC-UHFFFAOYSA-N | | SMILES | NCCOCCO[Si](C)(C(C)(C)C)C |
| WGK Germany | 3 | | Storage Class | 10 - Combustible liquids not in Storage Class 3 |
| | 2-[2-[[(1,1-Dimethylethyl)dimethylsilyl]oxy]ethoxy]ethanamine Usage And Synthesis |
| Uses | Novel tert--butyl dimethylsilyl (TBDMS) protected PEG amine linker. | | reaction suitability | reagent type: cross-linking reagent |
| | 2-[2-[[(1,1-Dimethylethyl)dimethylsilyl]oxy]ethoxy]ethanamine Preparation Products And Raw materials |
|