| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
Alfa Chemistry |
| Tel: |
1-516-6625404 |
| Email: |
support@alfa-chemistry.com |
| Company Name: |
Energy Chemical |
| Tel: |
021-58432009 400-005-6266 |
| Email: |
marketing@energy-chemical.com |
OH protected BIB manufacturers
|
| | OH protected BIB Basic information |
| Product Name: | OH protected BIB | | Synonyms: | (2,2-Dimethyl-1,3-dioxolan-4-yl)methyl 2-bromo-2-methylpropanoate;1-(DL-1,2-Isopropylideneglycerol) 2-bromoisobutyrate;1-(DL-1,2-Isopropylideneglyceryl) 2-bromoisobutyrate;OH protected BIB;Propanoic acid, 2-bromo-2-methyl-, (2,2-dimethyl-1,3-dioxolan-4-yl)methyl ester;1-(DL-1,2-Isopropylideneglyceryl) 2-bromoisobutyrate 97% | | CAS: | 258532-05-7 | | MF: | C10H17BrO4 | | MW: | 281.14 | | EINECS: | | | Product Categories: | | | Mol File: | 258532-05-7.mol |  |
| | OH protected BIB Chemical Properties |
| Boiling point | 294.4±25.0 °C(Predicted) | | density | 1.301 g/mL at 25 °C | | refractive index | n20/D1.461 | | Fp | >110℃ | | storage temp. | 2-8°C | | form | liquid | | InChI | 1S/C10H17BrO4/c1-9(2,11)8(12)13-5-7-6-14-10(3,4)15-7/h7H,5-6H2,1-4H3 | | InChIKey | BXRUOWPXJMBIIZ-UHFFFAOYSA-N | | SMILES | CC(C)(Br)C(=O)OCC1COC(C)(C)O1 |
| WGK Germany | 3 | | Storage Class | 10 - Combustible liquids |
| | OH protected BIB Usage And Synthesis |
| Uses | This ATRP initiator contains a protected OH functionality. |
| | OH protected BIB Preparation Products And Raw materials |
|