| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Products Intro: |
Product Name:2-(Diphenylphosphino)benzenesulfonic acid
CAS:111864-25-6
Purity:97% Package:1G Remarks:748420-1G
|
| Company Name: |
Shanghai Uchem Inc.
|
| Tel: |
15618758386 15618758386 |
| Email: |
sales3@myuchem.com |
| Products Intro: |
Product Name:ortho-(diphenyl-phosphino)-benzene sulphonic acid
CAS:111864-25-6
Purity:97% min. Package:25g;100g;250g;500g
|
|
| | 2-(Diphenylphosphino)benzenesulfonic acid Basic information |
| Product Name: | 2-(Diphenylphosphino)benzenesulfonic acid | | Synonyms: | 2-(Diphenylphosphino)benzenesulfonic acid;2-(Diphenylphosphino)benzenesulfonic acid 97%;ortho-(diphenyl-phosphino)-benzene sulphonic acid;2-(Diphenylphosphanyl)benzenesulfonic acid;2-Fluoro-10-methylbenzoicacid;Benzenesulfonic acid, 2-(diphenylphosphino)- | | CAS: | 111864-25-6 | | MF: | C18H15O3PS | | MW: | 342.35 | | EINECS: | | | Product Categories: | | | Mol File: | 111864-25-6.mol |  |
| | 2-(Diphenylphosphino)benzenesulfonic acid Chemical Properties |
| Melting point | 255-260°C | | storage temp. | 2-8°C, stored under nitrogen | | pka | -0.93±0.18(Predicted) | | form | solid | | Appearance | White to off-white Solid | | InChI | 1S/C18H15O3PS/c19-23(20,21)18-14-8-7-13-17(18)22(15-9-3-1-4-10-15)16-11-5-2-6-12-16/h1-14H,(H,19,20,21) | | InChIKey | HXVJDHROZFWXHT-UHFFFAOYSA-N | | SMILES | OS(=O)(=O)c1ccccc1P(c2ccccc2)c3ccccc3 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 2-(Diphenylphosphino)benzenesulfonic acid Usage And Synthesis |
| Uses | 2-(Diphenylphosphino)benzenesulfonic acid can be used as a ligand precursor for the preparation of various transition metal complexes, which are employed as catalysts in the different organic transformations such as Heck reaction, regioselective allylation, hydrogenation of ketones, N-alkylation of amines, and olefin oligomerization and polymerization reactions. |
| | 2-(Diphenylphosphino)benzenesulfonic acid Preparation Products And Raw materials |
|