| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | 3-Fluoro-4-iodoaniline Basic information |
| | 3-Fluoro-4-iodoaniline Chemical Properties |
| Melting point | 76-77 °C | | Boiling point | 273.7±25.0 °C(Predicted) | | density | 2.008±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | form | Solid | | pka | 2.79±0.10(Predicted) | | Appearance | Off-white to light yellow Solid | | Water Solubility | Slightly soluble in water (228.3 mg/L at 25°C). | | Sensitive | Light Sensitive | | InChI | InChI=1S/C6H5FIN/c7-5-3-4(9)1-2-6(5)8/h1-3H,9H2 | | InChIKey | KUVVJHBHRIXJKI-UHFFFAOYSA-N | | SMILES | C1(N)=CC=C(I)C(F)=C1 | | CAS DataBase Reference | 656-66-6(CAS DataBase Reference) |
| HazardClass | 6.1 | | HS Code | 2921420090 |
| | 3-Fluoro-4-iodoaniline Usage And Synthesis |
| Chemical Properties | White or yellow crystalline powder | | Uses | 3-Fluoro-4-iodoaniline is an important raw material and intermediate used in organic synthesis, pharmaceuticals, agrochemicals and dyestuff fields. |
| | 3-Fluoro-4-iodoaniline Preparation Products And Raw materials |
|