| Company Name: |
Shanghai Jidu Biotechnology Co., Ltd. Gold
|
| Tel: |
13851761812 |
| Email: |
13851761812@163.com |
| Products Intro: |
Product Name:Diethyl malonate-d2
CAS:4303-49-5
Purity:98% Package:1g;5g;10g;100g
|
| Company Name: |
Shanghai Aladdin Bio-Chem Technology Co.,LTD
|
| Tel: |
400-6206333 13167063860 |
| Email: |
anhua.mao@aladdin-e.com |
| Products Intro: |
Product Name:Diethyl malonate-d₂
CAS:4303-49-5
Purity:≥95 atom% D,≥98% Package:1g/RMB 499.90
|
|
| | DIETHYL MALONATE-D2 Basic information |
| | DIETHYL MALONATE-D2 Chemical Properties |
| Melting point | -51--50 °C (lit.) | | Boiling point | 199 °C (lit.) | | density | 1.068 g/mL at 25 °C | | refractive index | n20/D 1.4134(lit.) | | Fp | 212 °F | | storage temp. | Refrigerator, under inert atmosphere | | solubility | Chloroform | | form | Oil | | color | Colourless | | InChI | InChI=1S/C7H12O4/c1-3-10-6(8)5-7(9)11-4-2/h3-5H2,1-2H3/i5D2 | | InChIKey | IYXGSMUGOJNHAZ-BFWBPSQCSA-N | | SMILES | C([2H])([2H])(C(=O)OCC)C(=O)OCC | | CAS Number Unlabeled | 105-53-3 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 |
| | DIETHYL MALONATE-D2 Usage And Synthesis |
| Uses | Diethyl Malonate-d2 is the isotope labelled analog of Diethyl Malonate (D444420). Diethyl Malonate occurs naturally in grapes and strawberries. It is used in the preparation of barbiturates, artificial flavourings, vitamin B1, and vitamin B6 as well as in perfumes. |
| | DIETHYL MALONATE-D2 Preparation Products And Raw materials |
|