| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | Dicyclopentenyloxyethyl methacrylate Basic information |
| Product Name: | Dicyclopentenyloxyethyl methacrylate | | Synonyms: | 2-methyl-,2-[[2,3,3a,4,7,7a(or3a,4,5,6,7,7a)-hexahydro-4,7-2-propenoicaci;2-Propenoicacid,2-methyl-,2-[[2,3,3a,4,7,7a(or3a,4,5,6,7,7a)-hexahydro-4,7-methano-1H-indenyl]oxy]ethylester;ETHYLENE GLYCOL DICYCLOPENTENYL ETHER METHACRYLATE;ETHYLENE GLYCOL DICYCLOPENTYL ETHER METHACRYLATE;DICYCLOPENTENYL-2-METHACRYLATE;2-[[2,3,3a,4,7,7a(or 3a,4,5,6,7,7a)-hexahydro-4,7-methano-1H-indenyl]oxy]ethyl methacrylate;dicyclopentenyloxyethyl-2-methacrylate(mixtureofisomersstabilized)94+%;2-Propenoic acid, 2-methyl-, 2-(3a,4,7,7a,?,?-hexahydro-4,7-methano-1H-indenyl)oxyethyl ester | | CAS: | 68586-19-6 | | MF: | C16H22O4 | | MW: | 278.34 | | EINECS: | 271-608-3 | | Product Categories: | Acrylic Monomers;Methacrylate;Monomers | | Mol File: | 68586-19-6.mol |  |
| | Dicyclopentenyloxyethyl methacrylate Chemical Properties |
| Boiling point | 115-120°C 1mm | | density | 1.064 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.497(lit.) | | Fp | >230 °F | | form | liquid | | InChI | InChI=1S/C16H22O4/c1-12(2)16(17)18-11-15(19-13-7-3-4-8-13)20-14-9-5-6-10-14/h7,9,15H,1,3-6,8,10-11H2,2H3 | | InChIKey | JMIZWXDKTUGEES-UHFFFAOYSA-N | | SMILES | C(OCC(OC1CCCC=1)OC1CCCC=1)(=O)C(=C)C | | EPA Substance Registry System | 2-(Dihydrocyclopentadienyloxy)ethyl methacrylate (68586-19-6) |
| Hazard Codes | Xi,N | | Risk Statements | 38-51/53 | | Safety Statements | 26-36-61-60 | | WGK Germany | 2 | | TSCA | TSCA listed | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Aquatic Chronic 2
Skin Irrit. 2 |
| | Dicyclopentenyloxyethyl methacrylate Usage And Synthesis |
| | Dicyclopentenyloxyethyl methacrylate Preparation Products And Raw materials |
|