(S)-(+)-2,2,2-TRIFLUORO-1-(9-ANTHRYL)ETHANOL manufacturers
|
| | (S)-(+)-2,2,2-TRIFLUORO-1-(9-ANTHRYL)ETHANOL Basic information |
| Product Name: | (S)-(+)-2,2,2-TRIFLUORO-1-(9-ANTHRYL)ETHANOL | | Synonyms: | (+)-ALPHA-(TRIFLUOROMETHYL)-9-ANTHRACENEMETHANOL;ALPHA-(TRIFLUOROMETHYL)-9-ANTHRACENEMETHANOL;(S)-(-)-2,2,2-TRIFLUORO-1-(9-ANTHRYL)ETHANOL;(S)-(+)-2,2,2-TRIFLUORO-1-(9-ANTHRYL)ETHANOL;(S)-(+)-2 2 2-TRIFLUORO-1-(9-ANTHRYL)-ETHANOL 98+% (98% EE/HPLC);(1S)-1-anthracen-9-yl-2,2,2-trifluoroethanol;(1S)-1-(9-anthracenyl)-2,2,2-trifluoroethanol;(S)-(+)-1-(9-ANTHRYL)-2,2,2-TRIFLUOROETHANOL | | CAS: | 60646-30-2 | | MF: | C16H11F3O | | MW: | 276.25 | | EINECS: | 262-348-1 | | Product Categories: | Analytical Chemistry;Anthracenes;e.e. / Absolute Configuration Determination (NMR);Enantiomer Excess & Absolute Configuration Determination | | Mol File: | 60646-30-2.mol |  |
| | (S)-(+)-2,2,2-TRIFLUORO-1-(9-ANTHRYL)ETHANOL Chemical Properties |
| Melting point | 132-135 °C(lit.) | | Boiling point | 423.1±45.0 °C(Predicted) | | density | 1.2578 (estimate) | | refractive index | 30.5 ° (C=1, CHCl3) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | pka | 11.91±0.30(Predicted) | | form | powder to crystal | | color | White to Light yellow to Green | | Optical Rotation | [α]25/D +29°, c = 6.3 in chloroform | | BRN | 4695162 | | InChI | 1S/C16H11F3O/c17-16(18,19)15(20)14-12-7-3-1-5-10(12)9-11-6-2-4-8-13(11)14/h1-9,15,20H/t15-/m0/s1 | | InChIKey | ICZHJFWIOPYQCA-HNNXBMFYSA-N | | SMILES | O[C@@H](c1c2ccccc2cc3ccccc13)C(F)(F)F | | CAS DataBase Reference | 60646-30-2(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | F | 10 | | HS Code | 29062900 | | Storage Class | 11 - Combustible Solids |
| | (S)-(+)-2,2,2-TRIFLUORO-1-(9-ANTHRYL)ETHANOL Usage And Synthesis |
| Chemical Properties | yellow crystalline powder | | Uses | (S)-(+)-1-(9-Anthryl)-2,2,2-trifluoroethanol has been used for the NMR spectral determination of optical purity (and in some cases, absolute configuration) of a wide variety of sulfoxides, lactones, amines, sulfinate esters, oxaziridines and allenes. | | General Description | (S)-(+)-1-(9-Anthryl)-2,2,2-trifluoroethanol is a chiral solvating agent (CSA). |
| | (S)-(+)-2,2,2-TRIFLUORO-1-(9-ANTHRYL)ETHANOL Preparation Products And Raw materials |
|