| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Ark Pharm, Inc. |
| Tel: |
847-367-3680 |
| Email: |
sales@arkpharminc.com |
|
| | Methyl 5-nitrosalicylate Basic information | | Synthesis |
| | Methyl 5-nitrosalicylate Chemical Properties |
| Melting point | 114-117°C | | Boiling point | 328.7±27.0 °C(Predicted) | | density | 1.432±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | solubility | Chloroform, DCM, Methanol | | form | Solid | | pka | 6.82±0.22(Predicted) | | color | White | | Water Solubility | Insoluble in water. | | InChI | InChI=1S/C8H7NO5/c1-14-8(11)6-4-5(9(12)13)2-3-7(6)10/h2-4,10H,1H3 | | InChIKey | UUBFELFUKFJSRD-UHFFFAOYSA-N | | SMILES | C(OC)(=O)C1=CC([N+]([O-])=O)=CC=C1O | | CAS DataBase Reference | 17302-46-4(CAS DataBase Reference) |
| Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | HS Code | 2918290090 |
| Provider | Language |
|
ALFA
| English |
| | Methyl 5-nitrosalicylate Usage And Synthesis |
| Synthesis | 
a: The starting material, salicylic acid (20 g, 145 mmol), was placed in a 250 mL three-necked round-bottom flask. Acetic acid (120 mL) was added and heated to 50 °C to dissolve the precipitate. The mixture was refluxed and stirred. Then, concentrated nitric acid (10 mL) was slowly added dropwise to the reaction solution over approximately 6 minutes. The mixture was heated and stirred continuously. The reaction was monitored by TLC and was completed in approximately 3 hours. The reaction solution was poured into ice water while still hot, resulting in the precipitation of a large amount of brown solid. After standing for a period of time, the mixture was filtered and the filter cake was washed with ice water to obtain a brownish-yellow solid, 2-hydroxy-5-nitrobenzoic acid. The filtrate was placed at 0°C to continue precipitating solids. This was filtered again, and the resulting solid was dried to a constant weight of 15.92 g (yield: 60%). This was set aside for the next step. Reaction step b: The product obtained above, 2-hydroxy-5-nitrobenzoic acid (15.92 g, 87 mmol), was placed in a 250 mL three-necked round-bottom flask. Methanol (150 mL) was added, and the mixture was heated to 70°C to dissolve. The mixture was refluxed and stirred. Then, 10 mL of concentrated sulfuric acid was added dropwise to the reaction solution. The reaction was allowed to proceed for 1 day. After TLC detection showed the reaction was complete, the reaction solution was poured into ice water while still hot, resulting in the precipitation of solids. After standing for a period of time, the mixture was filtered, and the filter cake was washed with ice water to obtain a white solid, METHYL 5-NITROSALICYLATE. The filtrate was placed at 0°C to continue precipitating solids. This was filtered again, and the resulting solid was dried to a constant weight. The pure product was then separated by column chromatography (petroleum ether: ethyl acetate, 40:1) to obtain 10.28 g (yield: 60%). | | Uses | 5-Nitrosalicylic Acid Methyl Ester is an salicylic acid derivative with anti-inflammatory effect against colitis. |
| | Methyl 5-nitrosalicylate Preparation Products And Raw materials |
|