|
|
| | METHYL 5-NITROSALICYLATE Basic information |
| | METHYL 5-NITROSALICYLATE Chemical Properties |
| Melting point | 114-117°C | | Boiling point | 328.7±27.0 °C(Predicted) | | density | 1.432±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | solubility | Chloroform, DCM, Methanol | | form | Solid | | pka | 6.82±0.22(Predicted) | | color | White | | Water Solubility | Insoluble in water. | | InChI | InChI=1S/C8H7NO5/c1-14-8(11)6-4-5(9(12)13)2-3-7(6)10/h2-4,10H,1H3 | | InChIKey | UUBFELFUKFJSRD-UHFFFAOYSA-N | | SMILES | C(OC)(=O)C1=CC([N+]([O-])=O)=CC=C1O | | CAS DataBase Reference | 17302-46-4(CAS DataBase Reference) |
| Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | HS Code | 2918290090 |
| Provider | Language |
|
ALFA
| English |
| | METHYL 5-NITROSALICYLATE Usage And Synthesis |
| Uses | 5-Nitrosalicylic Acid Methyl Ester is an salicylic acid derivative with anti-inflammatory effect against colitis. |
| | METHYL 5-NITROSALICYLATE Preparation Products And Raw materials |
|