1H-Imidazole polymer with 2-(chloromethyl)oxirane and morpholine manufacturers
- MOME
-
- $0.00 / 25KG
-
2023-04-29
- CAS:10882-76-0
- Min. Order: 1KG
- Purity: 40%
- Supply Ability: 100000
|
| | 1H-Imidazole polymer with 2-(chloromethyl)oxirane and morpholine Basic information |
| Product Name: | 1H-Imidazole polymer with 2-(chloromethyl)oxirane and morpholine | | Synonyms: | 1H-Imidazole polymer with 2-(chloromethyl)oxirane and morpholine;Aqueous cationic polymer MOME;MOME;Reaction product of imidazole, morpholine, epichlorohydrine and hydrochloric acid;ALPHA-Epichlorohydrin-1H-imidazole-morpholine tripolymer;MOME Cationic polymer in water;MOME(Aqueous cationic polymer);MOME (interMediate for zinc plating) | | CAS: | 109882-76-0 | | MF: | C10H18ClN3O2 | | MW: | 247.72 | | EINECS: | | | Product Categories: | | | Mol File: | 109882-76-0.mol |  |
| | 1H-Imidazole polymer with 2-(chloromethyl)oxirane and morpholine Chemical Properties |
| InChI | InChI=1S/C4H9NO.C3H5ClO.C3H4N2/c1-3-6-4-2-5-1;4-1-3-2-5-3;1-2-5-3-4-1/h5H,1-4H2;3H,1-2H2;1-3H,(H,4,5) | | InChIKey | WRTGHLKTHCGYEB-UHFFFAOYSA-N | | SMILES | C(C1OC1)Cl.C1NCCOC1.C1N=CNC=1 |
| | 1H-Imidazole polymer with 2-(chloromethyl)oxirane and morpholine Usage And Synthesis |
| Physical properties | Liquid | | Uses | MOME is used in cyanide, alkaline, cyanide-free zinc plating. As the main brightener, it is often used in conjunction with BPC48/34. |
| | 1H-Imidazole polymer with 2-(chloromethyl)oxirane and morpholine Preparation Products And Raw materials |
|