|
|
| | 4-HYDROXY-3-NITROBENZYL ALCOHOL Basic information |
| | 4-HYDROXY-3-NITROBENZYL ALCOHOL Chemical Properties |
| Melting point | 94-98 °C | | Boiling point | 298.4°C (rough estimate) | | density | 1.4523 (rough estimate) | | refractive index | 1.5500 (estimate) | | storage temp. | Sealed in dry,Room Temperature | | pka | 6.97±0.14(Predicted) | | Appearance | Yellow to brown Solid | | InChI | InChI=1S/C7H7NO4/c9-4-5-1-2-7(10)6(3-5)8(11)12/h1-3,9-10H,4H2 | | InChIKey | IMLGJYRKLCMJPI-UHFFFAOYSA-N | | SMILES | C1(CO)=CC=C(O)C([N+]([O-])=O)=C1 | | CAS DataBase Reference | 41833-13-0(CAS DataBase Reference) |
| Provider | Language |
|
ACROS
| English |
| | 4-HYDROXY-3-NITROBENZYL ALCOHOL Usage And Synthesis |
| Chemical Properties | bright yellow to light brown powder | | Uses | 4-Hydroxy-3-nitrobenzyl Alcohol is used in preparation of monoclonal IgG4 anti-human MET antibody and drug conjugates for cancer therapy. |
| | 4-HYDROXY-3-NITROBENZYL ALCOHOL Preparation Products And Raw materials |
|