|
|
| | 2-Amino-3-methyl-5-nitropyridine Basic information | | Uses |
| | 2-Amino-3-methyl-5-nitropyridine Chemical Properties |
| Melting point | 256-260 °C | | Boiling point | 276.04°C (rough estimate) | | density | 1.3682 (rough estimate) | | refractive index | 1.6500 (estimate) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | form | powder to crystal | | pka | 3.13±0.49(Predicted) | | color | Light yellow to Yellow to Orange | | BRN | 126947 | | InChI | InChI=1S/C6H7N3O2/c1-4-2-5(9(10)11)3-8-6(4)7/h2-3H,1H3,(H2,7,8) | | InChIKey | JLPYUDJJBGYXEZ-UHFFFAOYSA-N | | SMILES | C1(N)=NC=C([N+]([O-])=O)C=C1C | | CAS DataBase Reference | 18344-51-9(CAS DataBase Reference) |
| | 2-Amino-3-methyl-5-nitropyridine Usage And Synthesis |
| Uses | 2-Amino-3-methyl-5-nitropyridine is a pyridine derivative that can be used as a pharmaceutical intermediate. | | Chemical Properties | White to yellow crystalline powder. | | Synthesis | The general procedure for the synthesis of 2-amino-3-methyl-5-nitropyridine from 2-amino-3-methylpyridine was as follows: 3-methylpyridin-2-amine (5.0 g, 46.2 mmol) was dissolved in concentrated sulfuric acid (24 mL) and the mixture was cooled to 0 °C. At the same time, fuming nitric acid (density = 1.5, 3.5 mL) was cooled to 0 °C. Concentrated sulfuric acid (3.5 mL) was slowly added dropwise to the reaction mixture while keeping the temperature below 20°C. Subsequently, the stirred mixture was gradually warmed to 20 °C and transferred to a second flask in 3-5 mL batches. The second flask was heated to 35-40°C (note: the temperature should not exceed 40°C and the temperature should be carefully monitored after each addition of a new batch). Next, the reaction mixture was continued to be stirred at 50°C for 30 minutes. Once the reaction is complete, the mixture is cooled to room temperature and neutralized with concentrated ammonia. At this point, a precipitate is generated, which is filtered and washed sequentially with water and 50% aqueous DMFA (6 mL). Finally, the product was purified by recrystallization from DMFA to give 3-methyl-5-nitropyridin-2-amine (2.52 g, 35% yield). | | References | [1] Patent: EP1894924, 2008, A1. Location in patent: Page/Page column 36
[2] Journal of Organic Chemistry, 1949, vol. 14, p. 328,331
[3] Journal of the American Chemical Society, 1955, vol. 77, p. 3154 |
| | 2-Amino-3-methyl-5-nitropyridine Preparation Products And Raw materials |
|