| Company Name: |
DebyeTec.com Inc. |
| Tel: |
18086626237 18086626237 |
| Email: |
2693528373@qq.com |
|
| | 6-Chloro-4-(2-chlorophenyl)quinazoline-2-carbaldehyde Basic information |
| | 6-Chloro-4-(2-chlorophenyl)quinazoline-2-carbaldehyde Chemical Properties |
| Melting point | 159 °C | | Boiling point | 482.0±55.0 °C(Predicted) | | density | 1.437±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | solid | | pka | -1.29±0.30(Predicted) | | Major Application | pharmaceutical (small molecule) | | InChI | 1S/C15H8Cl2N2O/c16-9-5-6-13-11(7-9)15(19-14(8-20)18-13)10-3-1-2-4-12(10)17/h1-8H | | InChIKey | VUUITUUENPOMIU-UHFFFAOYSA-N | | SMILES | Clc1ccc2nc(C=O)nc(-c3ccccc3Cl)c2c1 |
| Hazard Codes | T,Xi | | Risk Statements | 25-36 | | Safety Statements | 26-45 | | RIDADR | UN 2811 6.1 / PGIII | | WGK Germany | WGK 3 | | HS Code | 2933997500 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral Aquatic Chronic 4 Eye Irrit. 2 |
| | 6-Chloro-4-(2-chlorophenyl)quinazoline-2-carbaldehyde Usage And Synthesis |
| Uses | An impurity of the anxiolytic and anticonvulsant drug Lorazepam (L469850). |
| | 6-Chloro-4-(2-chlorophenyl)quinazoline-2-carbaldehyde Preparation Products And Raw materials |
|