| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
Energy Chemical |
| Tel: |
021-58432009 400-005-6266 |
| Email: |
marketing@energy-chemical.com |
|
| | (E)-1-Hexene-1,2-diboronic acid bis(pinacol) ester Basic information |
| Product Name: | (E)-1-Hexene-1,2-diboronic acid bis(pinacol) ester | | Synonyms: | 2,2μ-[(1Z)-1-Butyl-1,2-ethenediyl]bis[4,4,5,5-tetramethyl-1,3,2-dioxaborolane], 1-[cis-1,2-Bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)]hexene;1-CIS-1,2-BIS(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)HEXENE;1,3,2-Dioxaborolane, 2,2'-[(1Z)-1-butyl-1,2-ethenediyl]bis[4,4,5,5-tetramethyl- (9CI);(E)-1-Hexene-1,2-diboronic acid bis(pinacol) ester;(E)-1-Hexene-1,2-diboronic acid bis(pinacol) ester | | CAS: | 312693-52-0 | | MF: | C18H34B2O4 | | MW: | 336.08 | | EINECS: | | | Product Categories: | | | Mol File: | 312693-52-0.mol |  |
| | (E)-1-Hexene-1,2-diboronic acid bis(pinacol) ester Chemical Properties |
| Boiling point | 292 °C(lit.) | | density | 0.954 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.455(lit.) | | Fp | >230 °F | | InChI | 1S/C18H34B2O4/c1-10-11-12-14(20-23-17(6,7)18(8,9)24-20)13-19-21-15(2,3)16(4,5)22-19/h13H,10-12H2,1-9H3/b14-13- | | InChIKey | SACOFNGKSPZAFQ-YPKPFQOOSA-N | | SMILES | [H]\C(B1OC(C)(C)C(C)(C)O1)=C(/CCCC)B2OC(C)(C)C(C)(C)O2 |
| WGK Germany | 3 | | Storage Class | 10 - Combustible liquids |
| | (E)-1-Hexene-1,2-diboronic acid bis(pinacol) ester Usage And Synthesis |
| | (E)-1-Hexene-1,2-diboronic acid bis(pinacol) ester Preparation Products And Raw materials |
|